[(3R,3aS,5aR,5bR,6R,7S,7aR,9S,11aS,11bR,12R,13aR,13bS)-12-acetyloxy-7,9-dihydroxy-5a,5b,11a,13b-tetramethyl-8-methylidene-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-6-yl] hexanoate
| Internal ID | efb18461-86fd-451a-99ed-65b25889b4bb |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
| IUPAC Name | [(3R,3aS,5aR,5bR,6R,7S,7aR,9S,11aS,11bR,12R,13aR,13bS)-12-acetyloxy-7,9-dihydroxy-5a,5b,11a,13b-tetramethyl-8-methylidene-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-6-yl] hexanoate |
| SMILES (Canonical) | CCCCCC(=O)OC1C(C2C(=C)C(CCC2(C3C1(C4(CCC5C(CCC5(C4CC3OC(=O)C)C)C(=C)C)C)C)C)O)O |
| SMILES (Isomeric) | CCCCCC(=O)O[C@H]1[C@H]([C@H]2C(=C)[C@H](CC[C@@]2([C@@H]3[C@@]1([C@@]4(CC[C@H]5[C@@H](CC[C@@]5([C@H]4C[C@H]3OC(=O)C)C)C(=C)C)C)C)C)O)O |
| InChI | InChI=1S/C37H58O6/c1-10-11-12-13-29(40)43-33-31(41)30-22(4)26(39)16-18-35(30,7)32-27(42-23(5)38)20-28-34(6)17-14-24(21(2)3)25(34)15-19-36(28,8)37(32,33)9/h24-28,30-33,39,41H,2,4,10-20H2,1,3,5-9H3/t24-,25-,26-,27+,28+,30+,31-,32+,33-,34-,35-,36+,37-/m0/s1 |
| InChI Key | ZRKKAXBYFPRZND-OADVWRLNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H58O6 |
| Molecular Weight | 598.90 g/mol |
| Exact Mass | 598.42333957 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 8.10 |
| There are no found synonyms. |
![2D Structure of [(3R,3aS,5aR,5bR,6R,7S,7aR,9S,11aS,11bR,12R,13aR,13bS)-12-acetyloxy-7,9-dihydroxy-5a,5b,11a,13b-tetramethyl-8-methylidene-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-6-yl] hexanoate](https://plantaedb.com/storage/docs/compounds/2023/11/08f95ed0-8502-11ee-9678-a5548e2ac881.jpg "2D Structure of [(3R,3aS,5aR,5bR,6R,7S,7aR,9S,11aS,11bR,12R,13aR,13bS)-12-acetyloxy-7,9-dihydroxy-5a,5b,11a,13b-tetramethyl-8-methylidene-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-6-yl] hexanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.59% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.91% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 97.14% | 97.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.53% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.44% | 90.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 94.34% | 98.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.49% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.19% | 92.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.16% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.06% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 90.02% | 82.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.84% | 82.69% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.42% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.37% | 89.63% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.31% | 91.24% |
| CHEMBL1871 | P10275 | Androgen Receptor | 88.20% | 96.43% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.45% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.32% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.38% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.17% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.11% | 96.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.92% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.73% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.94% | 93.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.36% | 86.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.81% | 96.38% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.62% | 96.61% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.42% | 95.50% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.08% | 85.94% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.96% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.95% | 97.29% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.76% | 93.03% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.33% | 97.50% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.05% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eurycorymbus cavaleriei |
| PubChem | 50900111 |
| LOTUS | LTS0113998 |
| wikiData | Q105382050 |