[(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E,6R)-8-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2,6-dimethyloct-2-enoate
| Internal ID | 67abf694-fdde-494c-9cb1-44a77aa4dafc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
| IUPAC Name | [(1S,4aR,5R,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (E,6R)-8-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2,6-dimethyloct-2-enoate |
| SMILES (Canonical) | CC(CCC=C(C)C(=O)OC1CC(C2C1C=COC2OC3C(C(C(C(O3)CO)O)O)O)(C)O)CCOC4C(C(C(O4)CO)O)O |
| SMILES (Isomeric) | C[C@H](CC/C=C(\C)/C(=O)O[C@@H]1C[C@]([C@@H]2[C@H]1C=CO[C@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)(C)O)CCO[C@@H]4[C@H]([C@@H]([C@H](O4)CO)O)O |
| InChI | InChI=1S/C30H48O15/c1-14(7-9-41-28-24(36)22(34)19(13-32)43-28)5-4-6-15(2)26(38)42-17-11-30(3,39)20-16(17)8-10-40-27(20)45-29-25(37)23(35)21(33)18(12-31)44-29/h6,8,10,14,16-25,27-29,31-37,39H,4-5,7,9,11-13H2,1-3H3/b15-6+/t14-,16+,17-,18-,19-,20-,21-,22-,23+,24+,25-,27+,28+,29+,30+/m1/s1 |
| InChI Key | YNIHZPBSIYUTGJ-UZBQTSGDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H48O15 |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.29932082 g/mol |
| Topological Polar Surface Area (TPSA) | 234.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.70% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.04% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.80% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.52% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.54% | 97.25% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.89% | 98.75% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.70% | 91.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.03% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.89% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.35% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.51% | 96.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.58% | 94.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.47% | 99.17% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.39% | 96.61% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.95% | 94.08% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.72% | 96.21% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.57% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.24% | 93.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.11% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.73% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.53% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Buddleja japonica |
| PubChem | 162902642 |
| LOTUS | LTS0047115 |
| wikiData | Q105350949 |