[(1S,2R,7S,10S,11S,14R,15R,16R,19S)-7-[5-[5-[4-hydroxy-5-[4-methoxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-14,16-dimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-10-yl]methyl acetate
| Internal ID | 716a7d1e-dee0-4553-88b7-aa35c2c9490d |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [(1S,2R,7S,10S,11S,14R,15R,16R,19S)-7-[5-[5-[4-hydroxy-5-[4-methoxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-14,16-dimethyl-17,20,21-trioxahexacyclo[14.4.1.01,14.02,11.05,10.015,19]henicos-4-en-10-yl]methyl acetate |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4CCC5(C6CCC7(C8C9COC8(OC7(C6CC=C5C4)O9)C)C)COC(=O)C)C)C)O)OC1CC(C(C(O1)C)OC1C(C(C(C(O1)CO)O)O)O)OC |
| SMILES (Isomeric) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)O[C@H]4CC[C@@]5([C@H]6CC[C@@]7([C@@H]8[C@H]9CO[C@@]8(O[C@]7([C@@H]6CC=C5C4)O9)C)C)COC(=O)C)C)C)O)OC1CC(C(C(O1)C)OC1C(C(C(C(O1)CO)O)O)O)OC |
| InChI | InChI=1S/C56H88O23/c1-25-47(74-42-21-37(65-10)50(28(4)71-42)77-52-46(62)45(61)44(60)38(22-57)73-52)34(59)18-40(68-25)75-48-27(3)70-43(20-36(48)64-9)76-49-26(2)69-41(19-35(49)63-8)72-31-13-16-55(24-66-29(5)58)30(17-31)11-12-33-32(55)14-15-53(6)51-39-23-67-54(51,7)79-56(33,53)78-39/h11,25-28,31-52,57,59-62H,12-24H2,1-10H3/t25?,26?,27?,28?,31-,32-,33+,34?,35?,36?,37?,38?,39+,40?,41?,42?,43?,44?,45?,46?,47?,48?,49?,50?,51-,52?,53+,54+,55+,56-/m0/s1 |
| InChI Key | WTSRDWWLWHSPEH-YLQCICHRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H88O23 |
| Molecular Weight | 1129.30 g/mol |
| Exact Mass | 1128.57163905 g/mol |
| Topological Polar Surface Area (TPSA) | 275.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.32% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.76% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.04% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.50% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.98% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.09% | 86.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.72% | 91.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.46% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.22% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.54% | 89.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.92% | 95.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.58% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.94% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.70% | 94.45% |
| CHEMBL5028 | O14672 | ADAM10 | 83.78% | 97.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.43% | 92.50% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.12% | 97.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.55% | 97.79% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.28% | 94.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.70% | 97.14% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.53% | 98.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.29% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162948298 |
| LOTUS | LTS0171610 |
| wikiData | Q105312779 |