(3R,3aS,4'R,6S,6aR)-6a-hydroxy-4'-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,5'-oxolane]-2',5-dione
| Internal ID | a04d364f-82d5-4ce0-9e71-623259902ff0 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | (3R,3aS,4'R,6S,6aR)-6a-hydroxy-4'-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,5'-oxolane]-2',5-dione |
| SMILES (Canonical) | C1C(C2(C(=O)OC3C2(OCC3OC4C(C(C(C(O4)CO)O)O)O)O)OC1=O)C5=CC=C(C=C5)O |
| SMILES (Isomeric) | C1[C@@H]([C@]2(C(=O)O[C@@H]3[C@]2(OC[C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)OC1=O)C5=CC=C(C=C5)O |
| InChI | InChI=1S/C21H24O13/c22-6-11-14(25)15(26)16(27)18(31-11)32-12-7-30-21(29)17(12)33-19(28)20(21)10(5-13(24)34-20)8-1-3-9(23)4-2-8/h1-4,10-12,14-18,22-23,25-27,29H,5-7H2/t10-,11-,12-,14-,15+,16-,17+,18+,20-,21-/m1/s1 |
| InChI Key | FIACXLFECBTPBC-ZUBFEHACSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H24O13 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.12169082 g/mol |
| Topological Polar Surface Area (TPSA) | 202.00 Ų |
| XlogP | -2.50 |
| There are no found synonyms. |
![2D Structure of (3R,3aS,4'R,6S,6aR)-6a-hydroxy-4'-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,5'-oxolane]-2',5-dione](https://plantaedb.com/storage/docs/compounds/2023/11/0829d230-87d0-11ee-8b61-71849e7b709b.jpg "2D Structure of (3R,3aS,4'R,6S,6aR)-6a-hydroxy-4'-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,5'-oxolane]-2',5-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.81% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.50% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.05% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.76% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.97% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.32% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.55% | 95.56% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.04% | 85.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.75% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.49% | 85.14% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.64% | 89.67% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.47% | 94.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.17% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.15% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Viburnum dilatatum |
| PubChem | 162920066 |
| LOTUS | LTS0158855 |
| wikiData | Q104995567 |