4-(5,16,24-Trihydroxy-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2(7),3,5,10(29),11,13(28),15(27),16,18,22,25-dodecaen-17-yl)-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2,4,6,10(29),11,13(28),15,17,19(27),22,25-dodecaene-5,16,24-triol
Internal ID | 13f3d31e-ed77-4a70-8918-bd1889610d8f |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 4-(5,16,24-trihydroxy-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2(7),3,5,10(29),11,13(28),15(27),16,18,22,25-dodecaen-17-yl)-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2,4,6,10(29),11,13(28),15,17,19(27),22,25-dodecaene-5,16,24-triol |
SMILES (Canonical) | C1CC2=CC(=C(C=C2C3=C(C=C(CCC4=CC(=C(C=C4)O)OC5=CC=C1C=C5)C=C3)O)C6=C(C7=CC(=C6)CCC8=CC(=C(C=C8)C9=C(CCC1=CC=C(O7)C=C1)C=C(C=C9)O)O)O)O |
SMILES (Isomeric) | C1CC2=CC(=C(C=C2C3=C(C=C(CCC4=CC(=C(C=C4)O)OC5=CC=C1C=C5)C=C3)O)C6=C(C7=CC(=C6)CCC8=CC(=C(C=C8)C9=C(CCC1=CC=C(O7)C=C1)C=C(C=C9)O)O)O)O |
InChI | InChI=1S/C56H46O8/c57-41-16-23-44-39(30-41)14-5-33-9-19-43(20-10-33)64-55-29-38(4-3-36-11-21-45(44)51(59)26-36)25-49(56(55)62)48-32-47-40(31-53(48)61)15-6-34-7-17-42(18-8-34)63-54-28-37(13-24-50(54)58)2-1-35-12-22-46(47)52(60)27-35/h7-13,16-32,57-62H,1-6,14-15H2 |
InChI Key | COKMMTSCVUNTGM-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C56H46O8 |
Molecular Weight | 847.00 g/mol |
Exact Mass | 846.31926842 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 12.70 |
There are no found synonyms. |
![2D Structure of 4-(5,16,24-Trihydroxy-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2(7),3,5,10(29),11,13(28),15(27),16,18,22,25-dodecaen-17-yl)-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2,4,6,10(29),11,13(28),15,17,19(27),22,25-dodecaene-5,16,24-triol 2D Structure of 4-(5,16,24-Trihydroxy-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2(7),3,5,10(29),11,13(28),15(27),16,18,22,25-dodecaen-17-yl)-14-oxapentacyclo[20.2.2.210,13.115,19.02,7]nonacosa-1(24),2,4,6,10(29),11,13(28),15,17,19(27),22,25-dodecaene-5,16,24-triol](https://plantaedb.com/storage/docs/compounds/2023/11/07c4ac80-864f-11ee-9f73-a53ec1a5fa51.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.36% | 91.49% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 96.46% | 98.35% |
CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 93.80% | 97.90% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.78% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.20% | 98.95% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.50% | 91.79% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.48% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.92% | 90.71% |
CHEMBL3194 | P02766 | Transthyretin | 85.92% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.86% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.78% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.60% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.07% | 93.40% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.31% | 82.67% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.83% | 85.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.37% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Blasia pusilla |
PubChem | 10259971 |
LOTUS | LTS0132264 |
wikiData | Q104967112 |