(2R,4aS,6aS,8aR,10R,12aS,14aS,14bR)-10-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,8,8a,10,11,12,14,14b-dodecahydropicene-2-carboxylic acid
Internal ID | b06e92d7-5705-4c39-a38a-74ab3ec07efa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2R,4aS,6aS,8aR,10R,12aS,14aS,14bR)-10-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,3,4,5,6,8,8a,10,11,12,14,14b-dodecahydropicene-2-carboxylic acid |
SMILES (Canonical) | CC1(C(CCC2(C1CC=C3C2=CCC4(C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)C |
SMILES (Isomeric) | C[C@]12CC[C@@](C[C@H]1[C@@]3(CC=C4C(=CC[C@@H]5[C@@]4(CC[C@H](C5(C)C)OC(=O)/C=C/C6=CC(=C(C=C6)O)OC)C)[C@]3(CC2)C)C)(C)C(=O)O |
InChI | InChI=1S/C40H54O6/c1-35(2)30-13-11-27-26(15-18-40(7)31-24-37(4,34(43)44)20-19-36(31,3)21-22-39(27,40)6)38(30,5)17-16-32(35)46-33(42)14-10-25-9-12-28(41)29(23-25)45-8/h9-12,14-15,23,30-32,41H,13,16-22,24H2,1-8H3,(H,43,44)/b14-10+/t30-,31+,32+,36+,37+,38+,39+,40-/m0/s1 |
InChI Key | MKXOPSSUNSEZJV-HOJINGIMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H54O6 |
Molecular Weight | 630.90 g/mol |
Exact Mass | 630.39203944 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 9.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.23% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.56% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.22% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.73% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.32% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.10% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.23% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.46% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 88.03% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.01% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.73% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.02% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.67% | 91.19% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.41% | 91.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.15% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.80% | 95.50% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.46% | 94.78% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.68% | 91.07% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 81.79% | 83.65% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.58% | 97.14% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.26% | 91.71% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.26% | 91.79% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.77% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.72% | 96.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.38% | 100.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.00% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 101521935 |
LOTUS | LTS0224636 |
wikiData | Q105166297 |