methyl (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2R,3S,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-yl]oxyoxane-2-carboxylate
Internal ID | b20786e8-39bc-4d08-9502-cfbcddcab39c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2R,3S,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-yl]oxyoxane-2-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC2OC3C(C(C(OC3OC4CCC5(C(C4(C)CO)CCC6(C5CC=C7C6(CCC8(C7CC(CC8O)(C)C)C)C)C)C)C(=O)OC)O)O)CO)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O[C@H]2[C@@H]([C@H](O[C@@H]2O[C@@H]3[C@H]([C@@H]([C@H](O[C@H]3O[C@H]4CC[C@]5([C@H]([C@@]4(C)CO)CC[C@@]6([C@@H]5CC=C7[C@]6(CC[C@@]8([C@H]7CC(C[C@H]8O)(C)C)C)C)C)C)C(=O)OC)O)O)CO)O)O)O)O |
InChI | InChI=1S/C48H78O17/c1-22-30(52)32(54)35(57)40(60-22)64-37-31(53)25(20-49)61-41(37)65-38-34(56)33(55)36(39(58)59-9)63-42(38)62-29-13-14-45(5)26(46(29,6)21-50)12-15-48(8)27(45)11-10-23-24-18-43(2,3)19-28(51)44(24,4)16-17-47(23,48)7/h10,22,24-38,40-42,49-57H,11-21H2,1-9H3/t22-,24+,25-,26-,27-,28-,29+,30-,31-,32+,33+,34+,35+,36+,37+,38-,40-,41-,42-,44-,45+,46-,47-,48-/m1/s1 |
InChI Key | ADXLWRWWNRHRGL-SASAWYQRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H78O17 |
Molecular Weight | 927.10 g/mol |
Exact Mass | 926.52390102 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.44% | 91.11% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.99% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.26% | 96.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.68% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.79% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.59% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.03% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.98% | 91.07% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.75% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.74% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.42% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.09% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.55% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.33% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.85% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.35% | 93.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.16% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.08% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.06% | 99.17% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.66% | 91.65% |
CHEMBL5028 | O14672 | ADAM10 | 80.64% | 97.50% |
CHEMBL2581 | P07339 | Cathepsin D | 80.22% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus sinicus |
PubChem | 162986173 |
LOTUS | LTS0134124 |
wikiData | Q104909869 |