[(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-4-methoxy-5-[(2S,4S,5R,6R)-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate
Internal ID | a777e22c-f3d5-4cd0-aa67-e2f6645a02a0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-4-methoxy-5-[(2S,4S,5R,6R)-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2C3(CCC(CC3=CCC2(C4(C1(C(CC4)C(=O)C)C)O)O)OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9C(C(C(C(O9)CO)O)O)O)OC)OC)O)OC)C |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1C[C@@H]2[C@]3(CC[C@@H](CC3=CC[C@]2([C@@]4([C@]1([C@H](CC4)C(=O)C)C)O)O)O[C@H]5C[C@@H]([C@@H]([C@H](O5)C)O[C@H]6C[C@@H]([C@@H]([C@H](O6)C)O[C@H]7C[C@@H]([C@@H]([C@H](O7)C)O[C@H]8C[C@@H]([C@@H]([C@H](O8)C)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)OC)OC)O)OC)C |
InChI | InChI=1S/C59H94O23/c1-13-27(2)54(66)78-42-25-41-56(8)17-15-34(20-33(56)14-18-58(41,67)59(68)19-16-35(28(3)61)57(42,59)9)76-44-22-37(69-10)51(30(5)73-44)80-43-21-36(62)50(29(4)72-43)79-45-23-38(70-11)52(31(6)74-45)81-46-24-39(71-12)53(32(7)75-46)82-55-49(65)48(64)47(63)40(26-60)77-55/h13-14,29-32,34-53,55,60,62-65,67-68H,15-26H2,1-12H3/b27-13+/t29-,30-,31-,32-,34+,35-,36+,37+,38+,39+,40-,41-,42-,43+,44+,45+,46+,47-,48+,49-,50-,51-,52-,53-,55+,56+,57+,58+,59-/m1/s1 |
InChI Key | SFWDBOQPWSDGCG-FHLDEGQDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H94O23 |
Molecular Weight | 1171.40 g/mol |
Exact Mass | 1170.61858924 g/mol |
Topological Polar Surface Area (TPSA) | 305.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.92% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.54% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.18% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.25% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 90.69% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.34% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.00% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.84% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.17% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.70% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.86% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.45% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.29% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.88% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.25% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.07% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.79% | 95.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.71% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.16% | 97.25% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.53% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.43% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.25% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias syriaca |
PubChem | 25209440 |
LOTUS | LTS0263107 |
wikiData | Q105252097 |