(2R,3R,4S,5S,6R)-2-[(1S)-4-[(E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 988dec76-21bb-40c5-ab67-de88c8cda314 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1S)-4-[(E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1=C(C(CC(C1)OC2C(C(C(C(O2)CO)O)O)O)(C)C)C=CC(C)O |
SMILES (Isomeric) | CC1=C(C(C[C@H](C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)(C)C)/C=C/[C@@H](C)O |
InChI | InChI=1S/C19H32O7/c1-10-7-12(8-19(3,4)13(10)6-5-11(2)21)25-18-17(24)16(23)15(22)14(9-20)26-18/h5-6,11-12,14-18,20-24H,7-9H2,1-4H3/b6-5+/t11-,12+,14-,15-,16+,17-,18-/m1/s1 |
InChI Key | QCWVLOHTLDDUEL-HDXVEMSYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H32O7 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.21480336 g/mol |
Topological Polar Surface Area (TPSA) | 120.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of (2R,3R,4S,5S,6R)-2-[(1S)-4-[(E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2R,3R,4S,5S,6R)-2-[(1S)-4-[(E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-3-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/05d1b840-8576-11ee-ab10-f57388080052.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.90% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.74% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.77% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.37% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.10% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.93% | 97.09% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.82% | 97.47% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.70% | 94.45% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.41% | 96.47% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.07% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.94% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.12% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.79% | 97.25% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.35% | 86.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.20% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.76% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.39% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.10% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anethum graveolens |
PubChem | 162953633 |
LOTUS | LTS0135653 |
wikiData | Q105218635 |