3,7,10-Trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.02,6.07,13.010,14]pentadecane-2,6,9,11,13,14-hexol
| Internal ID | 15986503-cacf-4371-a143-da17dc2096d6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3,7,10-trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.02,6.07,13.010,14]pentadecane-2,6,9,11,13,14-hexol |
| SMILES (Canonical) | CC1CCC2(C1(C3C4(C5(C(CC4(C2(CC5(O3)O)C)O)(C(C)C)O)C)O)O)O |
| SMILES (Isomeric) | CC1CCC2(C1(C3C4(C5(C(CC4(C2(CC5(O3)O)C)O)(C(C)C)O)C)O)O)O |
| InChI | InChI=1S/C20H32O7/c1-10(2)15(21)9-17(23)13(4)8-18(24)14(15,5)20(17,26)12(27-18)19(25)11(3)6-7-16(13,19)22/h10-12,21-26H,6-9H2,1-5H3 |
| InChI Key | ONNAELIRVNIBLE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.21480336 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
![2D Structure of 3,7,10-Trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.02,6.07,13.010,14]pentadecane-2,6,9,11,13,14-hexol](https://plantaedb.com/storage/docs/compounds/2023/11/05c53420-884b-11ee-8a44-838aafcd3fd6.jpg "2D Structure of 3,7,10-Trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.02,6.07,13.010,14]pentadecane-2,6,9,11,13,14-hexol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.01% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.90% | 96.09% |
| CHEMBL238 | Q01959 | Dopamine transporter | 90.59% | 95.88% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.26% | 97.79% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.78% | 97.93% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.65% | 96.47% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.61% | 96.38% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.57% | 95.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.36% | 97.09% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.86% | 98.05% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 86.01% | 95.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.81% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.94% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.86% | 93.56% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.65% | 98.46% |
| CHEMBL4072 | P07858 | Cathepsin B | 83.53% | 93.67% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.40% | 92.86% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.91% | 89.05% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.59% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.11% | 82.69% |
| CHEMBL3837 | P07711 | Cathepsin L | 80.97% | 96.61% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.95% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.53% | 91.03% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.42% | 99.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.42% | 85.11% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.30% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.16% | 92.62% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.13% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Persea indica |
| PubChem | 73820792 |
| LOTUS | LTS0104100 |
| wikiData | Q105194954 |