[(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-1-oxo-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-methoxybenzoate
| Internal ID | 1aa6fc1d-b7ac-4ac9-aae8-1a95ba91f9cc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-1-oxo-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-methoxybenzoate |
| SMILES (Canonical) | CC1=CCC2(C(C(C1)OC(=O)C3=CC=C(C=C3)OC)C(CC2=O)(C(C)C)O)C |
| SMILES (Isomeric) | CC1=CC[C@@]2([C@@H]([C@H](C1)OC(=O)C3=CC=C(C=C3)OC)[C@@](CC2=O)(C(C)C)O)C |
| InChI | InChI=1S/C23H30O5/c1-14(2)23(26)13-19(24)22(4)11-10-15(3)12-18(20(22)23)28-21(25)16-6-8-17(27-5)9-7-16/h6-10,14,18,20,26H,11-13H2,1-5H3/t18-,20+,22-,23+/m0/s1 |
| InChI Key | DSWFZUNJNNREPE-VOFXCDAESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-1-oxo-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-methoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/0590c460-8786-11ee-b784-ad67610fed59.jpg "2D Structure of [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-1-oxo-3-propan-2-yl-3a,4,5,8-tetrahydro-2H-azulen-4-yl] 4-methoxybenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.68% | 90.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.65% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.68% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.18% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.99% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.02% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.89% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.64% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.75% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.98% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.69% | 91.19% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.52% | 91.07% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.14% | 93.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.76% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.73% | 97.79% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 83.32% | 94.97% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.44% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ferula arrigonii |
| PubChem | 101713149 |
| LOTUS | LTS0079928 |
| wikiData | Q104988062 |