[(3S,4S,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-yl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-4-(3,4-dihydroxyphenyl)but-2-enoate
Internal ID | cf0c8946-2857-4154-9122-b6773b81556b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(3S,4S,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-yl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-4-(3,4-dihydroxyphenyl)but-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)OC5C(C(C(C(O5)COC(=O)C=CCC6=CC(=C(C=C6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1[C@H]([C@@H](C([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O[C@H]5C([C@H]([C@@H](C(O5)COC(=O)/C=C/CC6=CC(=C(C=C6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C37H38O19/c1-14-27(44)30(47)32(49)36(52-14)56-35-29(46)26-21(42)11-17(38)12-23(26)53-34(35)16-6-8-19(40)22(10-16)54-37-33(50)31(48)28(45)24(55-37)13-51-25(43)4-2-3-15-5-7-18(39)20(41)9-15/h2,4-12,14,24,27-28,30-33,36-42,44-45,47-50H,3,13H2,1H3/b4-2+/t14?,24?,27-,28-,30+,31+,32?,33?,36+,37-/m1/s1 |
InChI Key | XHXVLRZUTJFZBB-FVSJBEQDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H38O19 |
Molecular Weight | 786.70 g/mol |
Exact Mass | 786.20072898 g/mol |
Topological Polar Surface Area (TPSA) | 312.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of [(3S,4S,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-yl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-4-(3,4-dihydroxyphenyl)but-2-enoate 2D Structure of [(3S,4S,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-yl]-2-hydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-4-(3,4-dihydroxyphenyl)but-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/0581aac0-8673-11ee-a894-0954a02cc649.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.98% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.08% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.45% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.43% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 96.31% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.18% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.64% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.54% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.06% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.33% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.96% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.40% | 86.92% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.09% | 80.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.66% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.51% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.20% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.16% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.73% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.56% | 95.89% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.66% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Blepharis ciliaris |
PubChem | 163054860 |
LOTUS | LTS0045952 |
wikiData | Q105328367 |