5-(1-hydroxyethyl)-3-[hydroxy-(1,3,6-trimethyl-2-penta-1,3-dienyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methylidene]pyrrolidine-2,4-dione
| Internal ID | 1172a4bd-be1b-4784-bf9e-53336251da9a |
| Taxonomy | Organoheterocyclic compounds > Pyrrolines |
| IUPAC Name | 5-(1-hydroxyethyl)-3-[hydroxy-(1,3,6-trimethyl-2-penta-1,3-dienyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methylidene]pyrrolidine-2,4-dione |
| SMILES (Canonical) | CC=CC=CC1C(=CC2CC(CCC2C1(C)C(=C3C(=O)C(NC3=O)C(C)O)O)C)C |
| SMILES (Isomeric) | CC=CC=CC1C(=CC2CC(CCC2C1(C)C(=C3C(=O)C(NC3=O)C(C)O)O)C)C |
| InChI | InChI=1S/C25H35NO4/c1-6-7-8-9-18-15(3)13-17-12-14(2)10-11-19(17)25(18,5)23(29)20-22(28)21(16(4)27)26-24(20)30/h6-9,13-14,16-19,21,27,29H,10-12H2,1-5H3,(H,26,30) |
| InChI Key | ISHIUSZGAFLPLK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.25660860 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.63% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.21% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.56% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.89% | 96.09% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.15% | 85.30% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.23% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.02% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.36% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.29% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.88% | 90.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.27% | 92.88% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.35% | 93.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.85% | 94.75% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.75% | 85.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.74% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.64% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.55% | 96.47% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.59% | 93.04% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.26% | 93.31% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.19% | 93.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.97% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.87% | 90.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.27% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76178303 |
| LOTUS | LTS0116556 |
| wikiData | Q104169076 |