3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxychromen-4-one
Internal ID | 96c3c498-0fde-4da4-9af7-b4085f3ed89a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxychromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(=C(C2=O)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)O)O)O)O)O)C5=CC(=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC(=C(C2=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)C5=CC(=C(C=C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O |
InChI | InChI=1S/C34H42O22/c1-49-11-5-13(39)19-15(6-11)50-29(10-2-3-14(12(38)4-10)51-32-26(46)23(43)20(40)16(7-35)52-32)31(22(19)42)56-34-28(48)25(45)30(18(9-37)54-34)55-33-27(47)24(44)21(41)17(8-36)53-33/h2-6,16-18,20-21,23-28,30,32-41,43-48H,7-9H2,1H3/t16-,17-,18-,20-,21-,23+,24+,25-,26-,27-,28-,30-,32-,33+,34+/m1/s1 |
InChI Key | UCDRIXCTPNMJDE-HOQLDGDMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H42O22 |
Molecular Weight | 802.70 g/mol |
Exact Mass | 802.21677296 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -3.30 |
There are no found synonyms. |
![2D Structure of 3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxychromen-4-one 2D Structure of 3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/051d9890-82d6-11ee-b0c8-939ac6a317c2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.98% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.19% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.67% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.41% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.86% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.71% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.54% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.27% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.20% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.12% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.22% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.79% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.92% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.79% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.27% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.28% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.82% | 96.21% |
CHEMBL3194 | P02766 | Transthyretin | 80.31% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Meehania urticifolia |
Nervilia fordii |
PubChem | 44179500 |
LOTUS | LTS0268132 |
wikiData | Q105269832 |