1',5',7,10'-tetramethyl-6-(3-oxobutyl)spiro[4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-3,14'-7-oxatetracyclo[10.2.1.02,11.04,8]pentadec-2(11)-ene]-2,6'-dione
| Internal ID | 703c3c04-64a9-4af0-98d4-ed9b9940c15b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Xanthanolides |
| IUPAC Name | 1',5',7,10'-tetramethyl-6-(3-oxobutyl)spiro[4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-3,14'-7-oxatetracyclo[10.2.1.02,11.04,8]pentadec-2(11)-ene]-2,6'-dione |
| SMILES (Canonical) | CC1CC2C(CC=C1CCC(=O)C)C3(CC4CC3(C5=C4C(CC6C(C5)C(C(=O)O6)C)C)C)C(=O)O2 |
| SMILES (Isomeric) | CC1CC2C(CC=C1CCC(=O)C)C3(CC4CC3(C5=C4C(CC6C(C5)C(C(=O)O6)C)C)C)C(=O)O2 |
| InChI | InChI=1S/C30H40O5/c1-15-10-25-22(9-8-19(15)7-6-17(3)31)30(28(33)35-25)14-20-13-29(30,5)23-12-21-18(4)27(32)34-24(21)11-16(2)26(20)23/h8,15-16,18,20-22,24-25H,6-7,9-14H2,1-5H3 |
| InChI Key | PBRFBLDLWSWNGY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28757437 g/mol |
| Topological Polar Surface Area (TPSA) | 69.70 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of 1',5',7,10'-tetramethyl-6-(3-oxobutyl)spiro[4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-3,14'-7-oxatetracyclo[10.2.1.02,11.04,8]pentadec-2(11)-ene]-2,6'-dione](https://plantaedb.com/storage/docs/compounds/2023/11/04fcc610-8743-11ee-830f-4f67f3f46b2b.jpg "2D Structure of 1',5',7,10'-tetramethyl-6-(3-oxobutyl)spiro[4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-3,14'-7-oxatetracyclo[10.2.1.02,11.04,8]pentadec-2(11)-ene]-2,6'-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.01% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.45% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.65% | 86.33% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.09% | 85.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.47% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.24% | 96.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.07% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.65% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.36% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.26% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helichrysum splendidum |
| PubChem | 14282667 |
| LOTUS | LTS0111628 |
| wikiData | Q105205365 |