(24S)-3beta-[2-O-(alpha-L-Arabinopyranosyl)-3-O-acetyl-alpha-L-arabinopyranosyloxy]-6alpha-(beta-D-glucopyranosyloxy)cycloartane-16beta,24,25-triol
Internal ID | 91a8fcc5-1ced-4e09-b695-c54ac1524c74 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(2S,3R,4S,5S)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-7,7,12,16-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl] acetate |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)OC(=O)C)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)O |
SMILES (Isomeric) | C[C@H](CC[C@@H](C(C)(C)O)O)[C@H]1[C@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2C[C@@H]([C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)OC(=O)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C)C)O |
InChI | InChI=1S/C48H80O19/c1-21(9-10-29(54)44(5,6)60)31-23(51)16-46(8)28-15-26(64-41-36(59)34(57)33(56)27(17-49)65-41)39-43(3,4)30(11-12-48(39)20-47(28,48)14-13-45(31,46)7)66-42-38(37(63-22(2)50)25(53)19-62-42)67-40-35(58)32(55)24(52)18-61-40/h21,23-42,49,51-60H,9-20H2,1-8H3/t21-,23+,24+,25+,26+,27-,28+,29+,30+,31+,32+,33-,34+,35-,36-,37+,38-,39+,40+,41-,42+,45-,46+,47+,48-/m1/s1 |
InChI Key | PBHICKWSHXWPEQ-WAITYCARSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H80O19 |
Molecular Weight | 961.10 g/mol |
Exact Mass | 960.52938032 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | 0.50 |
Atomic LogP (AlogP) | -0.40 |
H-Bond Acceptor | 19 |
H-Bond Donor | 11 |
Rotatable Bonds | 13 |
There are no found synonyms. |
![2D Structure of (24S)-3beta-[2-O-(alpha-L-Arabinopyranosyl)-3-O-acetyl-alpha-L-arabinopyranosyloxy]-6alpha-(beta-D-glucopyranosyloxy)cycloartane-16beta,24,25-triol 2D Structure of (24S)-3beta-[2-O-(alpha-L-Arabinopyranosyl)-3-O-acetyl-alpha-L-arabinopyranosyloxy]-6alpha-(beta-D-glucopyranosyloxy)cycloartane-16beta,24,25-triol](https://plantaedb.com/storage/docs/compounds/2023/11/04c8d9b0-7eeb-11ee-ae51-f9e51735f3b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6078 | 60.78% |
Caco-2 | - | 0.8878 | 88.78% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.6939 | 69.39% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8085 | 80.85% |
OATP1B3 inhibitior | + | 0.8998 | 89.98% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.6500 | 65.00% |
BSEP inhibitior | + | 0.7713 | 77.13% |
P-glycoprotein inhibitior | + | 0.7540 | 75.40% |
P-glycoprotein substrate | + | 0.6195 | 61.95% |
CYP3A4 substrate | + | 0.7425 | 74.25% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8804 | 88.04% |
CYP3A4 inhibition | - | 0.9251 | 92.51% |
CYP2C9 inhibition | - | 0.7950 | 79.50% |
CYP2C19 inhibition | - | 0.8502 | 85.02% |
CYP2D6 inhibition | - | 0.9519 | 95.19% |
CYP1A2 inhibition | - | 0.8924 | 89.24% |
CYP2C8 inhibition | + | 0.6876 | 68.76% |
CYP inhibitory promiscuity | - | 0.9717 | 97.17% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6989 | 69.89% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9063 | 90.63% |
Skin irritation | - | 0.6948 | 69.48% |
Skin corrosion | - | 0.9469 | 94.69% |
Ames mutagenesis | - | 0.5948 | 59.48% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7500 | 75.00% |
Micronuclear | - | 0.8000 | 80.00% |
Hepatotoxicity | - | 0.6940 | 69.40% |
skin sensitisation | - | 0.9134 | 91.34% |
Respiratory toxicity | - | 0.5111 | 51.11% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | - | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.8244 | 82.44% |
Acute Oral Toxicity (c) | I | 0.5431 | 54.31% |
Estrogen receptor binding | + | 0.7803 | 78.03% |
Androgen receptor binding | + | 0.7392 | 73.92% |
Thyroid receptor binding | - | 0.5647 | 56.47% |
Glucocorticoid receptor binding | + | 0.6825 | 68.25% |
Aromatase binding | + | 0.6469 | 64.69% |
PPAR gamma | + | 0.7816 | 78.16% |
Honey bee toxicity | - | 0.5842 | 58.42% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
Fish aquatic toxicity | + | 0.8557 | 85.57% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.52% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 95.97% | 91.24% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.71% | 94.45% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 95.49% | 95.58% |
CHEMBL2581 | P07339 | Cathepsin D | 94.59% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 92.91% | 92.88% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.66% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.23% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.27% | 96.77% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 90.25% | 82.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.07% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.34% | 96.61% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.12% | 97.14% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.72% | 98.75% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.55% | 100.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.41% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.06% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.85% | 89.00% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 87.80% | 99.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.75% | 95.93% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.66% | 95.69% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.59% | 98.10% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.56% | 95.71% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.14% | 94.62% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.03% | 97.29% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.29% | 95.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.55% | 91.07% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.27% | 97.21% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.05% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 84.80% | 99.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.60% | 94.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.16% | 89.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.57% | 96.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.52% | 92.86% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.18% | 94.75% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.46% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.16% | 95.89% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 82.15% | 92.86% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.97% | 92.78% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.95% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.89% | 86.33% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.47% | 90.24% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.46% | 91.03% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.40% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.32% | 94.08% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.26% | 95.38% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.19% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.92% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.82% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.04% | 92.62% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.03% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus icmadophilus |
PubChem | 101514267 |
LOTUS | LTS0048827 |
wikiData | Q105205189 |