[3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 1e4cb631-99bf-4141-9433-3b847e4e1794 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [3-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-(acetyloxymethyl)-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC(=O)C=CC4=CC(=C(C=C4)O)OC)C5=CC=C(C=C5)O)OC(=O)C)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC(=O)/C=C/C4=CC(=C(C=C4)O)OC)C5=CC=C(C=C5)O)OC(=O)C)O)O |
InChI | InChI=1S/C35H32O16/c1-16(36)46-15-26-29(42)31(44)34(47-17(2)37)35(50-26)51-33-30(43)28-23(40)13-21(14-25(28)49-32(33)19-6-8-20(38)9-7-19)48-27(41)11-5-18-4-10-22(39)24(12-18)45-3/h4-14,26,29,31,34-35,38-40,42,44H,15H2,1-3H3/b11-5+/t26-,29-,31+,34-,35+/m1/s1 |
InChI Key | CNRUFHBCTLNEKQ-SFMWUBETSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H32O16 |
Molecular Weight | 708.60 g/mol |
Exact Mass | 708.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.59% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.66% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.84% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.13% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.57% | 94.45% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.14% | 95.64% |
CHEMBL3194 | P02766 | Transthyretin | 95.10% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.64% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.29% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.37% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.17% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.48% | 95.78% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.12% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.77% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.65% | 95.50% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.92% | 88.48% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.34% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.43% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.84% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.61% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.59% | 97.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.70% | 85.31% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.51% | 97.28% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.06% | 94.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.97% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quercus incana |
PubChem | 163190184 |
LOTUS | LTS0155357 |
wikiData | Q104966300 |