(13R,15S,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one
| Internal ID | 9753a44e-1f09-4e17-bf63-3b7f8673c2b4 |
| Taxonomy | Alkaloids and derivatives > Tacaman alkaloids |
| IUPAC Name | (13R,15S,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
| SMILES (Canonical) | CCC1CC2C3C4=C(CCN3C1)C5=CC=CC=C5N4C(=O)C2O |
| SMILES (Isomeric) | CC[C@@H]1C[C@H]2[C@@H]3C4=C(CCN3C1)C5=CC=CC=C5N4C(=O)[C@H]2O |
| InChI | InChI=1S/C19H22N2O2/c1-2-11-9-14-16-17-13(7-8-20(16)10-11)12-5-3-4-6-15(12)21(17)19(23)18(14)22/h3-6,11,14,16,18,22H,2,7-10H2,1H3/t11-,14+,16-,18+/m1/s1 |
| InChI Key | CFGWIGBXBJVRDV-ZHPMQELBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.168127949 g/mol |
| Topological Polar Surface Area (TPSA) | 45.50 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.71% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.09% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.01% | 97.25% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.95% | 95.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.54% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.85% | 98.59% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.39% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.19% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.75% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.48% | 97.09% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.48% | 91.76% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.79% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tabernaemontana eglandulosa |
| PubChem | 10924954 |
| LOTUS | LTS0125617 |
| wikiData | Q104956530 |