[(2S,3R,6R)-6-[(2S,3S,6R)-6-[(2R,3R,4R,5R,6S,7S)-7-[(1R,3S,5S,7S,9R,10S,12S,13S,14R,17E,19S,20S,22S,23E,27R,28R,29S,30S,31S,32R)-3-acetyloxy-5,7,9,20,22,28,29,30,31,32-decahydroxy-13,19,27-trimethyl-16-oxo-11,15,34-trioxatricyclo[28.3.1.010,12]tetratriaconta-17,23-dien-14-yl]-4,6-dihydroxy-3,5-dimethyloctan-2-yl]oxy-2-methyloxan-3-yl]oxy-2-methyloxan-3-yl] (E)-5-(5,8-dioxonaphthalen-2-yl)-3-hydroxy-2,4-dimethylpent-4-enoate
| Internal ID | 3eb0a1a0-f934-410d-86a1-0f0745985d8a |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(2S,3R,6R)-6-[(2S,3S,6R)-6-[(2R,3R,4R,5R,6S,7S)-7-[(1R,3S,5S,7S,9R,10S,12S,13S,14R,17E,19S,20S,22S,23E,27R,28R,29S,30S,31S,32R)-3-acetyloxy-5,7,9,20,22,28,29,30,31,32-decahydroxy-13,19,27-trimethyl-16-oxo-11,15,34-trioxatricyclo[28.3.1.010,12]tetratriaconta-17,23-dien-14-yl]-4,6-dihydroxy-3,5-dimethyloctan-2-yl]oxy-2-methyloxan-3-yl]oxy-2-methyloxan-3-yl] (E)-5-(5,8-dioxonaphthalen-2-yl)-3-hydroxy-2,4-dimethylpent-4-enoate |
| SMILES (Canonical) | CC1CCC=CC(CC(C(C=CC(=O)OC(C(C2C(O2)C(CC(CC(CC(CC3CC(C(C(O3)(C(C1O)O)O)O)O)OC(=O)C)O)O)O)C)C(C)C(C(C)C(C(C)C(C)OC4CCC(C(O4)C)OC5CCC(C(O5)C)OC(=O)C(C)C(C(=CC6=CC7=C(C=C6)C(=O)C=CC7=O)C)O)O)O)C)O)O |
| SMILES (Isomeric) | C[C@@H]1CC/C=C/[C@H](C[C@@H]([C@H](/C=C/C(=O)O[C@@H]([C@@H]([C@H]2[C@@H](O2)[C@@H](C[C@H](C[C@@H](C[C@@H](C[C@H]3C[C@H]([C@@H]([C@](O3)([C@H]([C@@H]1O)O)O)O)O)OC(=O)C)O)O)O)C)[C@@H](C)[C@H]([C@H](C)[C@H]([C@@H](C)[C@@H](C)O[C@H]4CC[C@@H]([C@@H](O4)C)O[C@@H]5CC[C@H]([C@@H](O5)C)OC(=O)C(C)C(/C(=C/C6=CC7=C(C=C6)C(=O)C=CC7=O)/C)O)O)O)C)O)O |
| InChI | InChI=1S/C75H114O27/c1-35-17-24-62(85)100-69(42(8)70-71(101-70)58(83)32-50(79)29-49(78)30-51(97-46(12)76)33-52-34-59(84)72(90)75(93,102-52)73(91)66(87)36(2)15-13-14-16-48(77)31-57(35)82)40(6)68(89)39(5)67(88)38(4)43(9)94-63-25-22-60(44(10)95-63)98-64-26-23-61(45(11)96-64)99-74(92)41(7)65(86)37(3)27-47-18-19-53-54(28-47)56(81)21-20-55(53)80/h14,16-21,24,27-28,35-36,38-45,48-52,57-61,63-73,77-79,82-84,86-91,93H,13,15,22-23,25-26,29-34H2,1-12H3/b16-14+,24-17+,37-27+/t35-,36+,38-,39+,40-,41?,42-,43+,44-,45-,48+,49-,50-,51-,52-,57-,58+,59+,60-,61+,63+,64+,65?,66+,67-,68-,69+,70-,71-,72-,73-,75-/m0/s1 |
| InChI Key | OKYZPPPUAQTHME-ICFZGTQFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C75H114O27 |
| Molecular Weight | 1447.70 g/mol |
| Exact Mass | 1446.75474836 g/mol |
| Topological Polar Surface Area (TPSA) | 435.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL275 | Q07343 | Phosphodiesterase 4B |
480 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 98.94% | 97.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.92% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.61% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.49% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.77% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.58% | 96.77% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.40% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.92% | 91.49% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.92% | 97.79% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.74% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.42% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.43% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.40% | 91.07% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.96% | 97.25% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.61% | 85.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.50% | 86.33% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 90.03% | 92.51% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.51% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.95% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.80% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.35% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.84% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.07% | 97.14% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.35% | 97.33% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.30% | 83.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.05% | 99.17% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.01% | 85.31% |
| CHEMBL4072 | P07858 | Cathepsin B | 82.56% | 93.67% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.45% | 94.80% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.42% | 97.28% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.25% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.05% | 96.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.05% | 90.24% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.91% | 96.38% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.75% | 94.08% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.35% | 85.30% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.26% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.54% | 99.23% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.07% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 60155232 |
| LOTUS | LTS0085428 |
| wikiData | Q75059454 |