(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | c5cd909a-5707-4e46-a0be-beb054bb5262 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O |
InChI | InChI=1S/C50H82O22/c1-20(18-64-44-40(61)38(59)35(56)30(16-51)68-44)8-13-50(63)21(2)32-29(72-50)15-27-25-7-6-23-14-24(9-11-48(23,4)26(25)10-12-49(27,32)5)67-47-43(71-46-41(62)37(58)33(54)22(3)66-46)42(36(57)31(17-52)69-47)70-45-39(60)34(55)28(53)19-65-45/h6,20-22,24-47,51-63H,7-19H2,1-5H3/t20-,21+,22+,24+,25-,26+,27+,28-,29+,30-,31-,32+,33+,34+,35-,36+,37-,38+,39-,40-,41-,42+,43-,44-,45+,46+,47-,48+,49+,50-/m1/s1 |
InChI Key | MPMJTPUDGSNZCJ-WDQAFMDJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H82O22 |
Molecular Weight | 1035.20 g/mol |
Exact Mass | 1034.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 346.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.81% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.18% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.72% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.33% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.64% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.01% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.40% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.62% | 93.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.49% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.68% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.27% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.04% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.81% | 96.61% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.54% | 92.86% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.48% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.32% | 89.05% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 83.97% | 95.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.54% | 94.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.44% | 94.08% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.86% | 91.24% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.37% | 92.88% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 81.94% | 98.35% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.54% | 92.78% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.00% | 96.90% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 80.76% | 87.38% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.73% | 98.46% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.70% | 93.18% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.21% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lasiocarpum |
PubChem | 163034177 |
LOTUS | LTS0130345 |
wikiData | Q105169600 |