[(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-yl] acetate
| Internal ID | 09d6534a-e5a5-44d5-8d1c-c620dec9ba2d |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [(3S,6R)-6-[(1R,3R,6S,7S,8R,11S,12S,14S,15R,16R)-14-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-yl] acetate |
| SMILES (Canonical) | CC(CCC(C(C)(C)OC1C(C(C(C(O1)CO)O)O)O)OC(=O)C)C2C(CC3(C2(CCC45C3CCC6C4(C5)CCC(C6(C)CO)OC7C(C(C(C(O7)CO)O)O)O)C)C)O |
| SMILES (Isomeric) | C[C@H](CC[C@@H](C(C)(C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC(=O)C)[C@H]2[C@H](C[C@@]3([C@@]2(CC[C@@]45[C@H]3CC[C@@H]6[C@]4(C5)CC[C@@H]([C@]6(C)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)O |
| InChI | InChI=1S/C44H74O16/c1-21(8-11-28(56-22(2)48)39(3,4)60-38-36(55)34(53)32(51)25(18-46)58-38)30-23(49)16-42(7)27-10-9-26-40(5,20-47)29(59-37-35(54)33(52)31(50)24(17-45)57-37)12-13-43(26)19-44(27,43)15-14-41(30,42)6/h21,23-38,45-47,49-55H,8-20H2,1-7H3/t21-,23+,24-,25-,26+,27+,28+,29+,30+,31-,32-,33+,34+,35-,36-,37+,38+,40-,41-,42+,43-,44-/m1/s1 |
| InChI Key | GZXPRQBHVHIUNP-ZEQCLZRWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C44H74O16 |
| Molecular Weight | 859.00 g/mol |
| Exact Mass | 858.49768627 g/mol |
| Topological Polar Surface Area (TPSA) | 266.00 Ų |
| XlogP | 2.10 |
| Atomic LogP (AlogP) | 0.50 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 13 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6078 | 60.78% |
| Caco-2 | - | 0.8870 | 88.70% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.8571 | 85.71% |
| Subcellular localzation | Mitochondria | 0.6939 | 69.39% |
| OATP2B1 inhibitior | - | 0.8743 | 87.43% |
| OATP1B1 inhibitior | + | 0.8432 | 84.32% |
| OATP1B3 inhibitior | + | 0.8998 | 89.98% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6500 | 65.00% |
| BSEP inhibitior | + | 0.6392 | 63.92% |
| P-glycoprotein inhibitior | + | 0.7650 | 76.50% |
| P-glycoprotein substrate | + | 0.5000 | 50.00% |
| CYP3A4 substrate | + | 0.7231 | 72.31% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8746 | 87.46% |
| CYP3A4 inhibition | - | 0.9251 | 92.51% |
| CYP2C9 inhibition | - | 0.7950 | 79.50% |
| CYP2C19 inhibition | - | 0.8502 | 85.02% |
| CYP2D6 inhibition | - | 0.9519 | 95.19% |
| CYP1A2 inhibition | - | 0.8924 | 89.24% |
| CYP2C8 inhibition | + | 0.6104 | 61.04% |
| CYP inhibitory promiscuity | - | 0.9717 | 97.17% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.6989 | 69.89% |
| Eye corrosion | - | 0.9902 | 99.02% |
| Eye irritation | - | 0.9073 | 90.73% |
| Skin irritation | - | 0.6948 | 69.48% |
| Skin corrosion | - | 0.9469 | 94.69% |
| Ames mutagenesis | - | 0.6648 | 66.48% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7624 | 76.24% |
| Micronuclear | - | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.6308 | 63.08% |
| skin sensitisation | - | 0.9134 | 91.34% |
| Respiratory toxicity | - | 0.5667 | 56.67% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | - | 0.5500 | 55.00% |
| Nephrotoxicity | + | 0.5785 | 57.85% |
| Acute Oral Toxicity (c) | I | 0.5431 | 54.31% |
| Estrogen receptor binding | + | 0.7583 | 75.83% |
| Androgen receptor binding | + | 0.7712 | 77.12% |
| Thyroid receptor binding | - | 0.6027 | 60.27% |
| Glucocorticoid receptor binding | + | 0.6728 | 67.28% |
| Aromatase binding | + | 0.6539 | 65.39% |
| PPAR gamma | + | 0.7586 | 75.86% |
| Honey bee toxicity | - | 0.6589 | 65.89% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.8557 | 85.57% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.57% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.71% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.34% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.79% | 96.61% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.21% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.27% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.89% | 89.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.08% | 98.75% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 89.71% | 100.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.52% | 91.24% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.30% | 82.50% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.54% | 89.34% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.31% | 96.21% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.57% | 97.47% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.29% | 96.77% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.79% | 94.75% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.64% | 98.10% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.20% | 95.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.91% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.76% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.31% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.30% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.26% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.17% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.40% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.68% | 92.86% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.59% | 92.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.36% | 93.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.31% | 91.07% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.11% | 92.88% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.88% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.60% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.40% | 94.33% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.20% | 92.78% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.93% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.77% | 85.14% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.06% | 97.29% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.01% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thalictrum fortunei |
| PubChem | 162992049 |
| LOTUS | LTS0254341 |
| wikiData | Q105024712 |