10-[5,13-Bis(3,4-dihydroxyphenyl)-6,9,17,19,21-pentahydroxy-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-7-yl]-7-(3,4-dihydroxyphenyl)-6,11-dihydroxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-3-one
Internal ID | c6051250-747d-4201-97d6-922b5fb0bbd2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 10-[5,13-bis(3,4-dihydroxyphenyl)-6,9,17,19,21-pentahydroxy-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaen-7-yl]-7-(3,4-dihydroxyphenyl)-6,11-dihydroxy-2,8-dioxatricyclo[7.3.1.05,13]trideca-1(13),9,11-trien-3-one |
SMILES (Canonical) | C1C2C(C(OC3=C(C(=CC(=C23)OC1=O)O)C4C(C(OC5=C4C(=CC6=C5C7C(C(O6)(OC8=CC(=CC(=C78)O)O)C9=CC(=C(C=C9)O)O)O)O)C1=CC(=C(C=C1)O)O)O)C1=CC(=C(C=C1)O)O)O |
SMILES (Isomeric) | C1C2C(C(OC3=C(C(=CC(=C23)OC1=O)O)C4C(C(OC5=C4C(=CC6=C5C7C(C(O6)(OC8=CC(=CC(=C78)O)O)C9=CC(=C(C=C9)O)O)O)O)C1=CC(=C(C=C1)O)O)O)C1=CC(=C(C=C1)O)O)O |
InChI | InChI=1S/C47H36O19/c48-18-10-26(55)34-30(11-18)65-47(17-3-6-22(51)25(54)9-17)46(61)39(34)37-31(66-47)14-28(57)36-38(41(60)43(64-45(36)37)16-2-5-21(50)24(53)8-16)35-27(56)13-29-33-19(12-32(58)62-29)40(59)42(63-44(33)35)15-1-4-20(49)23(52)7-15/h1-11,13-14,19,38-43,46,48-57,59-61H,12H2 |
InChI Key | NHIZNZFPJBEXMQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H36O19 |
Molecular Weight | 904.80 g/mol |
Exact Mass | 904.18507891 g/mol |
Topological Polar Surface Area (TPSA) | 326.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.58% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.84% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.02% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.60% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.60% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.21% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.07% | 96.12% |
CHEMBL236 | P41143 | Delta opioid receptor | 87.83% | 99.35% |
CHEMBL233 | P35372 | Mu opioid receptor | 86.34% | 97.93% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.14% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 85.85% | 98.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.86% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.61% | 95.89% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.53% | 95.71% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.49% | 93.04% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.40% | 90.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.19% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.18% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arachniodes carvifolia |
PubChem | 14889233 |
LOTUS | LTS0184604 |
wikiData | Q105179399 |