[6-[10,13-dimethyl-6,16-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-3-(2-hydroxypropan-2-yl)heptan-2-yl] acetate
| Internal ID | 5298e53c-bfdd-489d-a0d8-4053ed8022b5 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
| IUPAC Name | [6-[10,13-dimethyl-6,16-dioxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-3-(2-hydroxypropan-2-yl)heptan-2-yl] acetate |
| SMILES (Canonical) | CC(C(CCC(C)(C1C(=O)CC2C1(CCC3C2CC(=O)C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)O)C(C)(C)O)OC(=O)C |
| SMILES (Isomeric) | CC(C(CCC(C)(C1C(=O)CC2C1(CCC3C2CC(=O)C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)O)C(C)(C)O)OC(=O)C |
| InChI | InChI=1S/C37H60O12/c1-18(47-19(2)39)22(34(3,4)45)10-13-37(7,46)32-27(41)16-24-21-15-26(40)25-14-20(8-11-35(25,5)23(21)9-12-36(24,32)6)48-33-31(44)30(43)29(42)28(17-38)49-33/h18,20-25,28-33,38,42-46H,8-17H2,1-7H3 |
| InChI Key | JEUVQGUEZZSPHN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H60O12 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.40847734 g/mol |
| Topological Polar Surface Area (TPSA) | 200.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.21% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.65% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.26% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.06% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.92% | 85.14% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.82% | 98.10% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.88% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.60% | 97.79% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.49% | 93.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.93% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.82% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.11% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.90% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.35% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.72% | 92.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.63% | 96.61% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.41% | 90.08% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.48% | 93.04% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.40% | 96.21% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.00% | 95.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.77% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.55% | 92.62% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.18% | 89.34% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.43% | 86.33% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.30% | 89.05% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.18% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 81.51% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.96% | 99.17% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.92% | 89.50% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.86% | 94.97% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.72% | 96.47% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.34% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14608429 |
| LOTUS | LTS0174340 |
| wikiData | Q105126417 |