[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-14-hydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
| Internal ID | d7acd658-7b16-4c13-b1cc-77206f14072a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-14-hydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2C3(CC(C(C3(CCC24CC45C1C(C(CC5)OC6C(C(C(C(O6)CO)O)O)O)(C)C)C)C7(CCC(O7)C(C)(C)O)C)O)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1C[C@H]2[C@@]3(C[C@@H]([C@@H]([C@]3(CC[C@]24C[C@]45[C@@H]1C([C@H](CC5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)(C)C)C)[C@]7(CC[C@H](O7)C(C)(C)O)C)O)C |
| InChI | InChI=1S/C38H62O11/c1-19(40)46-21-15-23-35(7)16-20(41)29(36(8)11-9-25(49-36)33(4,5)45)34(35,6)13-14-37(23)18-38(37)12-10-24(32(2,3)30(21)38)48-31-28(44)27(43)26(42)22(17-39)47-31/h20-31,39,41-45H,9-18H2,1-8H3/t20-,21-,22+,23-,24-,25-,26+,27-,28+,29-,30-,31-,34+,35-,36+,37-,38+/m0/s1 |
| InChI Key | BFHFASVSYXCRDK-BZOWASKHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C38H62O11 |
| Molecular Weight | 694.90 g/mol |
| Exact Mass | 694.42921279 g/mol |
| Topological Polar Surface Area (TPSA) | 175.00 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.98% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.79% | 96.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.08% | 96.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.74% | 94.45% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.24% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.45% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.44% | 97.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.49% | 96.61% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.82% | 95.38% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.53% | 86.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.43% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.26% | 89.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.96% | 82.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.25% | 95.50% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.24% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.02% | 98.10% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.91% | 91.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.84% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.77% | 96.77% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.67% | 94.62% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.34% | 94.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.79% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.48% | 91.19% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.25% | 97.79% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.02% | 89.50% |
| CHEMBL204 | P00734 | Thrombin | 82.93% | 96.01% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.14% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.72% | 92.62% |
| CHEMBL4683 | Q12884 | Fibroblast activation protein alpha | 80.77% | 93.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus trimestris |
| PubChem | 102586381 |
| LOTUS | LTS0081444 |
| wikiData | Q104934170 |