2-[6-[6-[6-[6-[6-[[12,14-Dihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 66de0682-27b8-4822-9a3f-e237c43b538f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[6-[6-[6-[6-[6-[[12,14-dihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C4CC(C5(C(CCC5(C4CC=C3C2)O)C(C)O)C)O)C)OC)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1C(C(C(C(O1)CO)O)O)O)OC)OC)OC)OC |
SMILES (Isomeric) | CC1C(C(CC(O1)OC2CCC3(C4CC(C5(C(CCC5(C4CC=C3C2)O)C(C)O)C)O)C)OC)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1C(C(C(C(O1)CO)O)O)O)OC)OC)OC)OC |
InChI | InChI=1S/C62H104O24/c1-28(64)36-17-19-62(69)37-15-14-34-20-35(16-18-60(34,7)38(37)21-45(65)61(36,62)8)80-46-22-39(70-9)54(29(2)75-46)82-47-23-40(71-10)55(30(3)76-47)83-48-24-41(72-11)56(31(4)77-48)84-49-25-42(73-12)57(32(5)78-49)85-50-26-43(74-13)58(33(6)79-50)86-59-53(68)52(67)51(66)44(27-63)81-59/h14,28-33,35-59,63-69H,15-27H2,1-13H3 |
InChI Key | LBKJTEZODYQPBU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C62H104O24 |
Molecular Weight | 1233.50 g/mol |
Exact Mass | 1232.69175418 g/mol |
Topological Polar Surface Area (TPSA) | 299.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of 2-[6-[6-[6-[6-[6-[[12,14-Dihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[6-[6-[6-[6-[6-[[12,14-Dihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/038431a0-8707-11ee-945a-efa4ff54b754.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.53% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.57% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.80% | 85.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.08% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.07% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.67% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.62% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.45% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.92% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 89.93% | 98.95% |
CHEMBL4072 | P07858 | Cathepsin B | 87.04% | 93.67% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.00% | 97.79% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.71% | 94.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.04% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.68% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.54% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.07% | 92.62% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.63% | 92.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.57% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.51% | 93.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.72% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.51% | 92.86% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.31% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adonis amurensis |
PubChem | 75076780 |
LOTUS | LTS0070406 |
wikiData | Q105149387 |