[(1E,3S,3aR,5R,7S,7aS)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate
Internal ID | 5c3520a6-3b95-4ab8-8ea5-4f89c8be309a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [(1E,3S,3aR,5R,7S,7aS)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C2C(C(CC(C2=C)OC(=O)C=C(C)CC)C(C)C)C(=CC)C1=O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]2[C@H]([C@@H](C[C@H](C2=C)OC(=O)/C=C(\C)/CC)C(C)C)/C(=C\C)/C1=O |
InChI | InChI=1S/C26H38O5/c1-9-15(6)12-21(27)30-20-13-19(14(4)5)23-18(11-3)24(28)25(22(23)17(20)8)31-26(29)16(7)10-2/h11-12,14,16,19-20,22-23,25H,8-10,13H2,1-7H3/b15-12+,18-11+/t16-,19+,20-,22+,23+,25+/m1/s1 |
InChI Key | XTQQLVJPORCMAK-FHPFAYHESA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H38O5 |
Molecular Weight | 430.60 g/mol |
Exact Mass | 430.27192431 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 5.90 |
There are no found synonyms. |
![2D Structure of [(1E,3S,3aR,5R,7S,7aS)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate 2D Structure of [(1E,3S,3aR,5R,7S,7aS)-1-ethylidene-3-[(2R)-2-methylbutanoyl]oxy-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydroinden-5-yl] (E)-3-methylpent-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/03694530-853a-11ee-a681-df92db4c7596.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.26% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.31% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.10% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.96% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.48% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.18% | 90.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.56% | 89.34% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.24% | 96.47% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.86% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.54% | 91.19% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.07% | 95.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.57% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.52% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.20% | 97.09% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.19% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.41% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.53% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petasites tricholobus |
PubChem | 162926478 |
LOTUS | LTS0190073 |
wikiData | Q105341775 |