[6-[4,5-Dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-hydroxy-2-methylpropanoate
Internal ID | a741b7a7-cb76-4c55-b853-c883853be85d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [6-[4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-hydroxy-2-methylpropanoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O)O)OC6C(C(C(C(O6)COC(=O)C(C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O)O)OC6C(C(C(C(O6)COC(=O)C(C)CO)O)O)O |
InChI | InChI=1S/C37H46O22/c1-12(9-38)34(51)52-11-20-23(43)26(46)29(49)37(57-20)58-31-13(2)53-35(30(50)27(31)47)59-33-24(44)21-17(41)7-16(54-36-28(48)25(45)22(42)19(10-39)56-36)8-18(21)55-32(33)14-3-5-15(40)6-4-14/h3-8,12-13,19-20,22-23,25-31,35-43,45-50H,9-11H2,1-2H3 |
InChI Key | WRBXFHFSNJEQQL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H46O22 |
Molecular Weight | 842.70 g/mol |
Exact Mass | 842.24807309 g/mol |
Topological Polar Surface Area (TPSA) | 351.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
![2D Structure of [6-[4,5-Dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-hydroxy-2-methylpropanoate 2D Structure of [6-[4,5-Dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-hydroxy-2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/0309a220-8509-11ee-aca6-4d5820ae73d2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.50% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.71% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.26% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.25% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.10% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.15% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.92% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.83% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.66% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.91% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.58% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.51% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.25% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.95% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.75% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.38% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.00% | 96.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.40% | 96.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.21% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sinocrassula indica |
PubChem | 163030081 |
LOTUS | LTS0212913 |
wikiData | Q105311144 |