methyl 2-(3-acetyloxy-4a,8-dimethyl-7-propanoyloxy-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)prop-2-enoate
| Internal ID | 52cc7d5b-b63e-47e6-818d-9bd1534fc603 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | methyl 2-(3-acetyloxy-4a,8-dimethyl-7-propanoyloxy-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)prop-2-enoate |
| SMILES (Canonical) | CCC(=O)OC1CCC2(CC(C(CC2=C1C)C(=C)C(=O)OC)OC(=O)C)C |
| SMILES (Isomeric) | CCC(=O)OC1CCC2(CC(C(CC2=C1C)C(=C)C(=O)OC)OC(=O)C)C |
| InChI | InChI=1S/C21H30O6/c1-7-19(23)27-17-8-9-21(5)11-18(26-14(4)22)15(10-16(21)13(17)3)12(2)20(24)25-6/h15,17-18H,2,7-11H2,1,3-6H3 |
| InChI Key | CJFLOEYIQWKUBV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.20423867 g/mol |
| Topological Polar Surface Area (TPSA) | 78.90 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.91% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.21% | 96.38% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.59% | 94.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.56% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.65% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.21% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.11% | 85.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.82% | 92.62% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.56% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.29% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.08% | 90.17% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.89% | 94.80% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.57% | 97.25% |
| CHEMBL5028 | O14672 | ADAM10 | 81.70% | 97.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.44% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.35% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eriocephalus pauperrimus |
| PubChem | 13895625 |
| LOTUS | LTS0191609 |
| wikiData | Q104960980 |