(1R,13E,17S,18S,22S,33S)-18-[(1S)-1,2-dihydroxyethyl]-4,5,8,9,29,30-hexahydroxy-15,24-dioxo-16,19,23-trioxahexacyclo[23.7.1.12,6.07,12.017,22.027,32]tetratriaconta-2(34),3,5,7(12),8,10,13,20,25,27,29,31-dodecaene-20,33-dicarboxylic acid
Internal ID | ffd7530b-d7b3-4632-b5ff-c536d4a858ac |
Taxonomy | Lignans, neolignans and related compounds > Lignan lactones |
IUPAC Name | (1R,13E,17S,18S,22S,33S)-18-[(1S)-1,2-dihydroxyethyl]-4,5,8,9,29,30-hexahydroxy-15,24-dioxo-16,19,23-trioxahexacyclo[23.7.1.12,6.07,12.017,22.027,32]tetratriaconta-2(34),3,5,7(12),8,10,13,20,25,27,29,31-dodecaene-20,33-dicarboxylic acid |
SMILES (Canonical) | C1=CC(=C(C2=C1C=CC(=O)OC3C(C=C(OC3C(CO)O)C(=O)O)OC(=O)C4=CC5=CC(=C(C=C5C(C4C(=O)O)C6=CC2=C(C(=C6)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C2=C1/C=C/C(=O)O[C@H]3[C@H](C=C(O[C@H]3[C@H](CO)O)C(=O)O)OC(=O)C4=CC5=CC(=C(C=C5[C@H]([C@@H]4C(=O)O)C6=CC2=C(C(=C6)O)O)O)O)O)O |
InChI | InChI=1S/C35H28O17/c36-11-22(41)31-32-23(10-24(50-31)33(45)46)51-35(49)17-5-13-7-19(38)20(39)9-15(13)26(28(17)34(47)48)14-6-16(29(43)21(40)8-14)27-12(2-4-25(42)52-32)1-3-18(37)30(27)44/h1-10,22-23,26,28,31-32,36-41,43-44H,11H2,(H,45,46)(H,47,48)/b4-2+/t22-,23-,26+,28+,31-,32-/m0/s1 |
InChI Key | JXUUDAFDNVUHED-NTZRBVCLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H28O17 |
Molecular Weight | 720.60 g/mol |
Exact Mass | 720.13264942 g/mol |
Topological Polar Surface Area (TPSA) | 298.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of (1R,13E,17S,18S,22S,33S)-18-[(1S)-1,2-dihydroxyethyl]-4,5,8,9,29,30-hexahydroxy-15,24-dioxo-16,19,23-trioxahexacyclo[23.7.1.12,6.07,12.017,22.027,32]tetratriaconta-2(34),3,5,7(12),8,10,13,20,25,27,29,31-dodecaene-20,33-dicarboxylic acid 2D Structure of (1R,13E,17S,18S,22S,33S)-18-[(1S)-1,2-dihydroxyethyl]-4,5,8,9,29,30-hexahydroxy-15,24-dioxo-16,19,23-trioxahexacyclo[23.7.1.12,6.07,12.017,22.027,32]tetratriaconta-2(34),3,5,7(12),8,10,13,20,25,27,29,31-dodecaene-20,33-dicarboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/02ec4b90-844b-11ee-954e-85ae9087cec3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.81% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.18% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.37% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.29% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.91% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.44% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.63% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.17% | 89.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 90.17% | 96.37% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.40% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.83% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.97% | 99.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.71% | 94.62% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.14% | 97.25% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.22% | 90.71% |
CHEMBL3194 | P02766 | Transthyretin | 82.75% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.05% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.02% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.72% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bazzania trilobata |
PubChem | 162987688 |
LOTUS | LTS0076951 |
wikiData | Q105136809 |