(1S,4aS,6S,7R,7aS)-1-[(2S,3R,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid
Internal ID | cf6f9b77-235c-4e2c-b522-3f51ca44fe74 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,6S,7R,7aS)-1-[(2S,3R,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)COC(=O)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)O)O)O)O |
InChI | InChI=1S/C18H26O11/c1-6-10(20)3-8-9(16(24)25)4-27-17(12(6)8)29-18-15(23)14(22)13(21)11(28-18)5-26-7(2)19/h4,6,8,10-15,17-18,20-23H,3,5H2,1-2H3,(H,24,25)/t6-,8+,10-,11+,12+,13+,14-,15+,17-,18-/m0/s1 |
InChI Key | JDYPLWLMGOKQLK-DSXBNBRZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H26O11 |
Molecular Weight | 418.40 g/mol |
Exact Mass | 418.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.51% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.11% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.40% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.14% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.85% | 97.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.53% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.25% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.91% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.36% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.09% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.75% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.36% | 99.17% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.53% | 95.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.88% | 96.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.84% | 96.61% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.61% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos nux-vomica |
PubChem | 11750443 |
LOTUS | LTS0156642 |
wikiData | Q105125868 |