(6-ethenyl-6-methyl-3-methylidene-2-oxo-7-prop-1-en-2-yl-4,5,7,7a-tetrahydro-3aH-1-benzofuran-4-yl) acetate
| Internal ID | 0d43b722-605d-4785-a2f8-65f532adb271 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (6-ethenyl-6-methyl-3-methylidene-2-oxo-7-prop-1-en-2-yl-4,5,7,7a-tetrahydro-3aH-1-benzofuran-4-yl) acetate |
| SMILES (Canonical) | CC(=C)C1C2C(C(CC1(C)C=C)OC(=O)C)C(=C)C(=O)O2 |
| SMILES (Isomeric) | CC(=C)C1C2C(C(CC1(C)C=C)OC(=O)C)C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H22O4/c1-7-17(6)8-12(20-11(5)18)13-10(4)16(19)21-15(13)14(17)9(2)3/h7,12-15H,1-2,4,8H2,3,5-6H3 |
| InChI Key | OTDCMOJEHBGCAO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 3.70 |
| NSC173840 |
| DTXSID80971441 |
| NSC-173840 |
| 6-Ethenyl-6-methyl-3-methylidene-2-oxo-7-(prop-1-en-2-yl)octahydro-1-benzofuran-4-yl acetate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.23% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.59% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.07% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.08% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.98% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.76% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.71% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.78% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.41% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cassinia subtropica |
| Liriodendron tulipifera |
| Uvaria afzelii |
| PubChem | 299921 |
| LOTUS | LTS0079348 |
| wikiData | Q105167745 |