[(3R,5R,8R,9S,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | b16db27d-e47a-4141-ab7b-5466607747b8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3R,5R,8R,9S,10R,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(C)C(=C)CCC(C)C1CCC2(C1(CCC3C2CCC4C3(CCC(C4(C)C)OC(=O)C)C)C)C |
SMILES (Isomeric) | C[C@H](CCC(=C)C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@H](C4(C)C)OC(=O)C)C)C)C |
InChI | InChI=1S/C33H56O2/c1-21(2)22(3)11-12-23(4)25-15-19-33(10)27-13-14-28-30(6,7)29(35-24(5)34)17-18-31(28,8)26(27)16-20-32(25,33)9/h21,23,25-29H,3,11-20H2,1-2,4-10H3/t23-,25-,26+,27-,28+,29-,31-,32-,33+/m1/s1 |
InChI Key | XSOLHWFIHOJDTB-GKPMKVOLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H56O2 |
Molecular Weight | 484.80 g/mol |
Exact Mass | 484.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 11.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.77% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.25% | 83.82% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.49% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.54% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.63% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.32% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.44% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.29% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.43% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.28% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.29% | 97.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.63% | 95.17% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.61% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.39% | 89.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.23% | 96.77% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.16% | 97.79% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.12% | 89.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.09% | 96.47% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 83.83% | 89.92% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.69% | 93.04% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.28% | 95.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.27% | 98.10% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.82% | 93.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.78% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.78% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.55% | 82.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.40% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.25% | 98.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.95% | 96.21% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.82% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.80% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.77% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.61% | 99.17% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.29% | 96.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.08% | 97.14% |
PubChem | 163022910 |
LOTUS | LTS0241348 |
wikiData | Q105341138 |