[(1R,2R,4S)-4-[(2R)-2-[(1R,9S,12S,15R,16Z,18R,19R,21R,23S,24Z,30S,32S,35R)-15-ethyl-1,18-dihydroxy-19,30-dimethoxy-17,21,23,29,35-pentamethyl-2,3,10,14,20-pentaoxo-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraen-12-yl]propyl]-2-methoxycyclohexyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate
| Internal ID | 9a5d2110-d451-4e1a-a620-70ce7d06d641 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolide lactams |
| IUPAC Name | [(1R,2R,4S)-4-[(2R)-2-[(1R,9S,12S,15R,16Z,18R,19R,21R,23S,24Z,30S,32S,35R)-15-ethyl-1,18-dihydroxy-19,30-dimethoxy-17,21,23,29,35-pentamethyl-2,3,10,14,20-pentaoxo-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraen-12-yl]propyl]-2-methoxycyclohexyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| SMILES (Canonical) | CCC1C=C(C(C(C(=O)C(CC(C=CC=CC=C(C(CC2CCC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(CC1=O)C(C)CC4CCC(C(C4)OC)OC(=O)C(C)(CO)CO)O)C)OC)C)C)C)OC)O)C |
| SMILES (Isomeric) | CC[C@@H]1/C=C(\[C@H]([C@H](C(=O)[C@@H](C[C@@H](/C=C\C=CC=C([C@H](C[C@@H]2CC[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H](CC1=O)[C@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)OC(=O)C(C)(CO)CO)O)C)OC)C)C)C)OC)O)/C |
| InChI | InChI=1S/C57H89NO16/c1-12-41-28-38(6)50(63)51(71-11)49(62)37(5)26-34(2)18-14-13-15-19-35(3)46(69-9)30-42-23-21-39(7)57(68,74-42)52(64)53(65)58-25-17-16-20-43(58)54(66)72-47(31-44(41)61)36(4)27-40-22-24-45(48(29-40)70-10)73-55(67)56(8,32-59)33-60/h13-15,18-19,28,34,36-37,39-43,45-48,50-51,59-60,63,68H,12,16-17,20-27,29-33H2,1-11H3/b15-13?,18-14-,35-19?,38-28-/t34-,36-,37-,39-,40+,41-,42+,43+,45-,46+,47+,48-,50-,51+,57-/m1/s1 |
| InChI Key | OZMZZJHYZQVAQQ-DAJWAWTCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C57H89NO16 |
| Molecular Weight | 1044.30 g/mol |
| Exact Mass | 1043.61813575 g/mol |
| Topological Polar Surface Area (TPSA) | 242.00 Ų |
| XlogP | 5.90 |
| CHEBI:200737 |
| [(1R,2R,4S)-4-[(2R)-2-[(1R,9S,12S,15R,16Z,18R,19R,21R,23S,24Z,30S,32S,35R)-15-ethyl-1,18-dihydroxy-19,30-dimethoxy-17,21,23,29,35-pentamethyl-2,3,10,14,20-pentaoxo-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraen-12-yl]propyl]-2-methoxycyclohexyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 99.82% | 97.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.25% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.99% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.90% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.85% | 93.56% |
| CHEMBL2052031 | Q13451 | Peptidyl-prolyl cis-trans isomerase FKBP5 | 93.61% | 88.00% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 92.98% | 92.78% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.67% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.61% | 86.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 92.60% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.94% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.48% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.59% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.41% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.71% | 94.73% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.93% | 96.90% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.87% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.49% | 95.71% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 87.18% | 90.93% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.16% | 96.38% |
| CHEMBL204 | P00734 | Thrombin | 86.27% | 96.01% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 85.99% | 92.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.72% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.69% | 92.62% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.20% | 97.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.09% | 92.88% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.80% | 96.77% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.69% | 98.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.56% | 91.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.30% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.30% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.27% | 89.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.54% | 90.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.24% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584123 |
| LOTUS | LTS0053465 |
| wikiData | Q77279891 |