[(1R,2R,3R,4S,5R,6R,7S,9R,10R,11S,14R,15R,16S,24S,26S)-10-hydroxy-9-(hydroxymethyl)-2,14,16-trimethyl-12-oxo-4-prop-1-en-2-yl-8,13,25,27,28,29-hexaoxaoctacyclo[13.10.1.14,24.15,24.111,14.01,6.07,9.011,26]nonacosan-3-yl] acetate
| Internal ID | 67fa0bc1-9432-4fe9-a96d-af693cfcc2ef |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(1R,2R,3R,4S,5R,6R,7S,9R,10R,11S,14R,15R,16S,24S,26S)-10-hydroxy-9-(hydroxymethyl)-2,14,16-trimethyl-12-oxo-4-prop-1-en-2-yl-8,13,25,27,28,29-hexaoxaoctacyclo[13.10.1.14,24.15,24.111,14.01,6.07,9.011,26]nonacosan-3-yl] acetate |
| SMILES (Canonical) | CC1CCCCCCCC23OC4C5C6C(O6)(C(C78C(C1C(O7)(OC8=O)C)C5(O2)C(C(C4(O3)C(=C)C)OC(=O)C)C)O)CO |
| SMILES (Isomeric) | C[C@H]1CCCCCCC[C@]23O[C@@H]4[C@H]5[C@H]6[C@](O6)([C@H]([C@]78[C@@H]([C@@H]1[C@](O7)(OC8=O)C)[C@@]5(O2)[C@@H]([C@H]([C@@]4(O3)C(=C)C)OC(=O)C)C)O)CO |
| InChI | InChI=1S/C32H44O11/c1-15(2)30-22(37-18(5)34)17(4)31-20-23-28(14-33,38-23)25(35)32-21(31)19(27(6,41-32)40-26(32)36)16(3)12-10-8-7-9-11-13-29(42-30,43-31)39-24(20)30/h16-17,19-25,33,35H,1,7-14H2,2-6H3/t16-,17+,19+,20+,21-,22+,23-,24+,25+,27-,28-,29+,30-,31+,32-/m0/s1 |
| InChI Key | SKISMDCNTKLSHQ-ASFKHAACSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H44O11 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28836222 g/mol |
| Topological Polar Surface Area (TPSA) | 143.00 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.29% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.04% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.79% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.55% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.58% | 96.61% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.57% | 91.19% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.87% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.63% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.10% | 92.62% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.94% | 82.69% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.88% | 95.50% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.66% | 96.77% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.52% | 91.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.29% | 94.45% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 84.94% | 95.27% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.65% | 93.04% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.05% | 98.03% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.47% | 89.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.05% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.40% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.21% | 92.32% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.94% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.75% | 97.14% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.70% | 89.63% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.05% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.00% | 89.00% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 80.65% | 97.63% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.41% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pimelea elongata |
| PubChem | 162864196 |
| LOTUS | LTS0125777 |
| wikiData | Q105254857 |