[15-(Acetyloxymethyl)-8-ethyl-7-hydroxy-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadec-14-en-13-yl] 2-(hydroxymethyl)prop-2-enoate
Internal ID | c10c51be-aa16-4a89-af38-2c09e74fd4cf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [15-(acetyloxymethyl)-8-ethyl-7-hydroxy-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadec-14-en-13-yl] 2-(hydroxymethyl)prop-2-enoate |
SMILES (Canonical) | CCC1C(=O)OC2(C1(CCC3(C(O3)C4C(=C(C(=O)O4)COC(=O)C)C(C2)OC(=O)C(=C)CO)C)O)C |
SMILES (Isomeric) | CCC1C(=O)OC2(C1(CCC3(C(O3)C4C(=C(C(=O)O4)COC(=O)C)C(C2)OC(=O)C(=C)CO)C)O)C |
InChI | InChI=1S/C25H32O11/c1-6-15-22(30)36-24(5)9-16(33-20(28)12(2)10-26)17-14(11-32-13(3)27)21(29)34-18(17)19-23(4,35-19)7-8-25(15,24)31/h15-16,18-19,26,31H,2,6-11H2,1,3-5H3 |
InChI Key | PWMYDLPGNYMRRV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H32O11 |
Molecular Weight | 508.50 g/mol |
Exact Mass | 508.19446183 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.52% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.39% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.53% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.74% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.71% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.96% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.12% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.29% | 91.19% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.87% | 94.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.15% | 97.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.13% | 82.69% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.38% | 98.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.13% | 95.56% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.11% | 82.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.33% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nageia nagi |
Nageia wallichiana |
PubChem | 85123464 |
LOTUS | LTS0077144 |
wikiData | Q105271252 |