11-Methoxy-4,4-dimethyl-3,15-dioxa-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),5,8,11,13,16-heptaene
| Internal ID | 0d34899b-3f0b-4eaf-8328-9e68db6ee510 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Pyranoquinolines |
| IUPAC Name | 11-methoxy-4,4-dimethyl-3,15-dioxa-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),5,8,11,13,16-heptaene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H15NO3/c1-17(2)8-6-10-4-5-11-13(14(10)21-17)18-16-12(7-9-20-16)15(11)19-3/h4-9H,1-3H3 |
| InChI Key | DKNUDTGFZIHLPC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 44.50 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of 11-Methoxy-4,4-dimethyl-3,15-dioxa-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),5,8,11,13,16-heptaene](https://plantaedb.com/storage/docs/compounds/2023/11/028204a0-85bf-11ee-a1a6-cdcea4576768.jpg "2D Structure of 11-Methoxy-4,4-dimethyl-3,15-dioxa-17-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),5,8,11,13,16-heptaene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.33% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.92% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.03% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.16% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.93% | 96.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.34% | 85.30% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.89% | 94.03% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.68% | 85.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.68% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.49% | 99.23% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.99% | 96.67% |
| CHEMBL251 | P29274 | Adenosine A2a receptor | 82.98% | 94.40% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.95% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.29% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Conchocarpus coeruleus |
| PubChem | 162820600 |
| LOTUS | LTS0056870 |
| wikiData | Q104983484 |