(1R,2S,3S,4S,5S,8S,9S,12R,13S)-5,13-dihydroxy-4,8,13-trimethyltetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid
| Internal ID | 058b10e0-b594-4fe7-9230-9140f6d16fb3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > C20-gibberellins > C20-gibberellin 6-carboxylic acids |
| IUPAC Name | (1R,2S,3S,4S,5S,8S,9S,12R,13S)-5,13-dihydroxy-4,8,13-trimethyltetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| SMILES (Canonical) | CC12CCC(C(C1C(C34C2CCC(C3)C(C4)(C)O)C(=O)O)(C)C(=O)O)O |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]([C@@]([C@H]1[C@@H]([C@]34[C@H]2CC[C@H](C3)[C@@](C4)(C)O)C(=O)O)(C)C(=O)O)O |
| InChI | InChI=1S/C20H30O6/c1-17-7-6-12(21)19(3,16(24)25)14(17)13(15(22)23)20-8-10(4-5-11(17)20)18(2,26)9-20/h10-14,21,26H,4-9H2,1-3H3,(H,22,23)(H,24,25)/t10-,11+,12+,13-,14+,17+,18+,19-,20-/m1/s1 |
| InChI Key | RQSMCCOZKPTKGL-PAGWOBONSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.20423867 g/mol |
| Topological Polar Surface Area (TPSA) | 115.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.19% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.11% | 96.38% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.34% | 90.17% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 87.40% | 87.16% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.74% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.29% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.49% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.06% | 93.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.67% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163043098 |
| LOTUS | LTS0133925 |
| wikiData | Q105243547 |