(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-2-[[(1S,2S,4S,6S,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]but-3-enyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 9acd5375-7697-4ef4-b548-091e8a2d03b4 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-2-[[(1S,2S,4S,6S,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]but-3-enyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)C)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(=C)COC9C(C(C(C(O9)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@@H](C[C@@H](C5)O)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)C)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O[C@]1(CCC(=C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)OC |
InChI | InChI=1S/C51H82O22/c1-20(18-65-45-41(62)39(60)37(58)31(17-52)69-45)10-13-51(64-7)21(2)33-30(73-51)16-28-26-9-8-24-14-25(53)15-32(50(24,6)27(26)11-12-49(28,33)5)70-48-44(72-47-42(63)38(59)34(55)22(3)67-47)43(35(56)23(4)68-48)71-46-40(61)36(57)29(54)19-66-46/h8,21-23,25-48,52-63H,1,9-19H2,2-7H3/t21-,22-,23+,25+,26+,27-,28-,29-,30-,31+,32+,33-,34-,35-,36-,37+,38+,39-,40+,41+,42+,43-,44+,45+,46-,47-,48-,49-,50-,51-/m0/s1 |
InChI Key | DAFLWXTWSYIXSX-DISDIWBOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H82O22 |
Molecular Weight | 1047.20 g/mol |
Exact Mass | 1046.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 335.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-2-[[(1S,2S,4S,6S,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]but-3-enyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-2-[[(1S,2S,4S,6S,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]but-3-enyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/0236a520-8625-11ee-b369-27fc63481fe7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.01% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.01% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.55% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.98% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.28% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.95% | 94.45% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.10% | 92.88% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.36% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.20% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 87.29% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.82% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.64% | 94.00% |
CHEMBL204 | P00734 | Thrombin | 84.41% | 96.01% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.85% | 99.17% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.70% | 96.43% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.63% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.39% | 92.50% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 83.13% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.78% | 95.89% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 82.38% | 95.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.11% | 97.25% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.96% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dracaena concinna |
PubChem | 162962602 |
LOTUS | LTS0075952 |
wikiData | Q104973510 |