[1,3a,5-Triacetyloxy-9-hydroxy-9a-(hydroxymethyl)-2,5-dimethyl-4-oxo-6-prop-1-en-2-yl-1,2,3,5a,6,9,10,10a-octahydrobenzo[f]azulen-10-yl] butanoate
| Internal ID | b6582f0d-d466-41a7-9d16-03d4cc99ccc9 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
| IUPAC Name | [1,3a,5-triacetyloxy-9-hydroxy-9a-(hydroxymethyl)-2,5-dimethyl-4-oxo-6-prop-1-en-2-yl-1,2,3,5a,6,9,10,10a-octahydrobenzo[f]azulen-10-yl] butanoate |
| SMILES (Canonical) | CCCC(=O)OC1C2C(C(CC2(C(=O)C(C3C1(C(C=CC3C(=C)C)O)CO)(C)OC(=O)C)OC(=O)C)C)OC(=O)C |
| SMILES (Isomeric) | CCCC(=O)OC1C2C(C(CC2(C(=O)C(C3C1(C(C=CC3C(=C)C)O)CO)(C)OC(=O)C)OC(=O)C)C)OC(=O)C |
| InChI | InChI=1S/C30H42O11/c1-9-10-22(36)39-26-23-24(38-17(5)32)16(4)13-30(23,41-19(7)34)27(37)28(8,40-18(6)33)25-20(15(2)3)11-12-21(35)29(25,26)14-31/h11-12,16,20-21,23-26,31,35H,2,9-10,13-14H2,1,3-8H3 |
| InChI Key | IZDXXILCPHEHGG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.27271215 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.26% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.13% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.07% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.80% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.38% | 86.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.53% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.19% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.55% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.55% | 99.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.77% | 94.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.25% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia polycaulis |
| PubChem | 163015420 |
| LOTUS | LTS0084598 |
| wikiData | Q105123137 |