7-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxymethyl]-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one
Internal ID | 96cb2df5-e1f8-4ee8-814f-450502d0f99b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxymethyl]-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(OC(C(C1O)O)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC6C(C(C(C(O6)C)O)O)O)O)O)C |
SMILES (Isomeric) | C[C@H]1[C@@H](O[C@H]([C@@H]([C@@H]1O)O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)O)O)C |
InChI | InChI=1S/C35H44O17/c1-13-14(2)47-33(30(43)25(13)38)46-12-23-27(40)29(42)32(52-34-31(44)28(41)26(39)15(3)48-34)35(51-23)49-18-9-19(36)24-20(37)11-21(50-22(24)10-18)16-5-7-17(45-4)8-6-16/h5-11,13-15,23,25-36,38-44H,12H2,1-4H3/t13-,14-,15-,23+,25+,26-,27+,28+,29-,30+,31+,32+,33+,34-,35+/m0/s1 |
InChI Key | DAVSWEXXVXXTSA-VLTOYACXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H44O17 |
Molecular Weight | 736.70 g/mol |
Exact Mass | 736.25784993 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.11% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.64% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.23% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.44% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.41% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.36% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.09% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.26% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.33% | 95.56% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 90.01% | 81.11% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.59% | 93.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.09% | 86.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.06% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.58% | 96.09% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.45% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.92% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.73% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.45% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.37% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.79% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.32% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja officinalis |
PubChem | 44575351 |
LOTUS | LTS0251675 |
wikiData | Q104974022 |