methyl (1R,4aS,5S,7S,7aR)-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 9cc92e60-9361-4b11-8b5c-08382b3e6ba9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1R,4aS,5S,7S,7aR)-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1CC(C2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1C[C@@H]([C@H]2[C@@H]1[C@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C23H36O15/c1-7-3-9(25)13-8(20(32)33-2)5-34-21(12(7)13)38-23-19(31)17(29)15(27)11(37-23)6-35-22-18(30)16(28)14(26)10(4-24)36-22/h5,7,9-19,21-31H,3-4,6H2,1-2H3/t7-,9-,10+,11+,12+,13-,14+,15+,16-,17-,18+,19+,21+,22+,23-/m0/s1 |
InChI Key | WRUPFIVZXCSYTA-TUWUHDQPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H36O15 |
Molecular Weight | 552.50 g/mol |
Exact Mass | 552.20542044 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.35% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.74% | 97.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.47% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.92% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.71% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.97% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.42% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.77% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.70% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.17% | 96.95% |
CHEMBL5028 | O14672 | ADAM10 | 80.13% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlomoides rotata |
PubChem | 162875151 |
LOTUS | LTS0238258 |
wikiData | Q105311597 |