9,10,16-Trihydroxy-4,17,20,21,24-pentamethyl-23-oxahexacyclo[11.10.1.01,19.03,12.04,9.016,24]tetracosa-6,20-diene-5,18,22-trione
Internal ID | 97581b48-c037-46d2-83df-ccc98a31b37c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | 9,10,16-trihydroxy-4,17,20,21,24-pentamethyl-23-oxahexacyclo[11.10.1.01,19.03,12.04,9.016,24]tetracosa-6,20-diene-5,18,22-trione |
SMILES (Canonical) | CC1C(=O)C2C(=C(C(=O)OC23CC4C(CC(C5(C4(C(=O)C=CC5)C)O)O)C6C3(C1(CC6)O)C)C)C |
SMILES (Isomeric) | CC1C(=O)C2C(=C(C(=O)OC23CC4C(CC(C5(C4(C(=O)C=CC5)C)O)O)C6C3(C1(CC6)O)C)C)C |
InChI | InChI=1S/C28H36O7/c1-13-14(2)23(32)35-28-12-18-16(11-20(30)27(34)9-6-7-19(29)24(18,27)4)17-8-10-26(33,25(17,28)5)15(3)22(31)21(13)28/h6-7,15-18,20-21,30,33-34H,8-12H2,1-5H3 |
InChI Key | YMNXFTUYIKXAPW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O7 |
Molecular Weight | 484.60 g/mol |
Exact Mass | 484.24610348 g/mol |
Topological Polar Surface Area (TPSA) | 121.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of 9,10,16-Trihydroxy-4,17,20,21,24-pentamethyl-23-oxahexacyclo[11.10.1.01,19.03,12.04,9.016,24]tetracosa-6,20-diene-5,18,22-trione 2D Structure of 9,10,16-Trihydroxy-4,17,20,21,24-pentamethyl-23-oxahexacyclo[11.10.1.01,19.03,12.04,9.016,24]tetracosa-6,20-diene-5,18,22-trione](https://plantaedb.com/storage/docs/compounds/2023/11/01ae3300-83c5-11ee-937d-3349ab8eca74.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.40% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.55% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.69% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.29% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.20% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.90% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.81% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.54% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.30% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.47% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.42% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.32% | 99.23% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.07% | 86.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.88% | 94.75% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.24% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.16% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jaborosa rotacea |
PubChem | 73016991 |
LOTUS | LTS0028792 |
wikiData | Q105350655 |