2-[(4R,5S,7R,18S,19S,20S,23S,24R,27S,28S,29S)-20-(carboxymethyl)-13,14,18,29,33,34-hexahydroxy-2,10,17,21,26,30-hexaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,16,22,25,31-heptaoxaheptacyclo[26.7.1.111,15.04,23.07,24.032,36.019,37]heptatriaconta-1(35),11,13,15(37),32(36),33-hexaen-27-yl]acetic acid
Internal ID | ad517047-4a45-4854-84bd-729f2cb2c79a |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[(4R,5S,7R,18S,19S,20S,23S,24R,27S,28S,29S)-20-(carboxymethyl)-13,14,18,29,33,34-hexahydroxy-2,10,17,21,26,30-hexaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,16,22,25,31-heptaoxaheptacyclo[26.7.1.111,15.04,23.07,24.032,36.019,37]heptatriaconta-1(35),11,13,15(37),32(36),33-hexaen-27-yl]acetic acid |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C(C7C(C(=O)OC8=C7C(=CC(=C8O)O)C(=O)O1)O)CC(=O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5[C@H]([C@@H](C(=O)O3)CC(=O)O)[C@@H](C(=O)O6)O)O)O)OC(=O)[C@H]([C@@H]7[C@@H](C(=O)OC8=C7C(=CC(=C8O)O)C(=O)O1)O)CC(=O)O |
InChI | InChI=1S/C41H32O28/c42-13-1-8(2-14(43)24(13)50)34(55)69-41-33-32-29(64-37(58)11(5-18(46)47)21-23-10(36(57)68-33)4-16(45)26(52)31(23)66-40(61)28(21)54)17(63-41)7-62-35(56)9-3-15(44)25(51)30-22(9)20(27(53)39(60)65-30)12(6-19(48)49)38(59)67-32/h1-4,11-12,17,20-21,27-29,32-33,41-45,50-54H,5-7H2,(H,46,47)(H,48,49)/t11-,12-,17+,20-,21-,27-,28-,29+,32-,33+,41-/m0/s1 |
InChI Key | RQCWVRZKLJDIFK-UEMQHOQISA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H32O28 |
Molecular Weight | 972.70 g/mol |
Exact Mass | 972.10801036 g/mol |
Topological Polar Surface Area (TPSA) | 450.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of 2-[(4R,5S,7R,18S,19S,20S,23S,24R,27S,28S,29S)-20-(carboxymethyl)-13,14,18,29,33,34-hexahydroxy-2,10,17,21,26,30-hexaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,16,22,25,31-heptaoxaheptacyclo[26.7.1.111,15.04,23.07,24.032,36.019,37]heptatriaconta-1(35),11,13,15(37),32(36),33-hexaen-27-yl]acetic acid 2D Structure of 2-[(4R,5S,7R,18S,19S,20S,23S,24R,27S,28S,29S)-20-(carboxymethyl)-13,14,18,29,33,34-hexahydroxy-2,10,17,21,26,30-hexaoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,16,22,25,31-heptaoxaheptacyclo[26.7.1.111,15.04,23.07,24.032,36.019,37]heptatriaconta-1(35),11,13,15(37),32(36),33-hexaen-27-yl]acetic acid](https://plantaedb.com/storage/docs/compounds/2023/11/01781f00-858e-11ee-a3d6-69364b85a2c3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.93% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.40% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 90.11% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.74% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.67% | 95.56% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 89.49% | 97.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.87% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.18% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.56% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.98% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.83% | 99.23% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.03% | 95.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.36% | 91.19% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.21% | 83.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.28% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.09% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.09% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 80.80% | 90.71% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.21% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia maculata |
PubChem | 162978315 |
LOTUS | LTS0229789 |
wikiData | Q105243238 |