(4R,9S,14R)-14-(4-hydroxyphenyl)-4,9-bis(2-hydroxypropan-2-yl)-3,8,13-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1,6,11-trien-16-one
| Internal ID | a57675f9-5354-4728-8d16-ceefccc89eeb |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
| IUPAC Name | (4R,9S,14R)-14-(4-hydroxyphenyl)-4,9-bis(2-hydroxypropan-2-yl)-3,8,13-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1,6,11-trien-16-one |
| SMILES (Canonical) | CC(C)(C1CC2=C3C(=C4C(=C2O1)CC(O4)C(C)(C)O)C(=O)CC(O3)C5=CC=C(C=C5)O)O |
| SMILES (Isomeric) | CC(C)([C@@H]1CC2=C3C(=C4C(=C2O1)C[C@@H](O4)C(C)(C)O)C(=O)C[C@@H](O3)C5=CC=C(C=C5)O)O |
| InChI | InChI=1S/C25H28O7/c1-24(2,28)18-9-14-21(31-18)15-10-19(25(3,4)29)32-23(15)20-16(27)11-17(30-22(14)20)12-5-7-13(26)8-6-12/h5-8,17-19,26,28-29H,9-11H2,1-4H3/t17-,18+,19-/m1/s1 |
| InChI Key | MLJXXOUQWDXXEA-CEXWTWQISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (4R,9S,14R)-14-(4-hydroxyphenyl)-4,9-bis(2-hydroxypropan-2-yl)-3,8,13-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1,6,11-trien-16-one](https://plantaedb.com/storage/docs/compounds/2023/11/016b9d10-85b1-11ee-ae3e-cda238944b61.jpg "2D Structure of (4R,9S,14R)-14-(4-hydroxyphenyl)-4,9-bis(2-hydroxypropan-2-yl)-3,8,13-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1,6,11-trien-16-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.04% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.27% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.84% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.62% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.37% | 85.14% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.95% | 98.35% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.85% | 94.73% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.94% | 90.93% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.78% | 85.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.38% | 89.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.46% | 85.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.47% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.42% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.07% | 99.23% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.30% | 100.00% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 80.12% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus minimiflorus |
| PubChem | 162929579 |
| LOTUS | LTS0163628 |
| wikiData | Q105166770 |