4-[(3R,3aR,6S,6aS)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol
Internal ID | bdfaed81-c629-429b-99e2-983f0694b6e9 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 4-[(3R,3aR,6S,6aS)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H]2[C@@H]3CO[C@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O |
InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14+,19-,20+ |
InChI Key | HGXBRUKMWQGOIE-YKLJGAPNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O6 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 77.40 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of 4-[(3R,3aR,6S,6aS)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol 2D Structure of 4-[(3R,3aR,6S,6aS)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/014cde20-84b1-11ee-8d87-27e75cfc6e76.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.84% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.44% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.89% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.29% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.65% | 86.33% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.65% | 88.48% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.96% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.79% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 82.48% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.12% | 99.15% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.11% | 92.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.94% | 91.49% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.87% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.63% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.70% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.65% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.15% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pandanus boninensis |
Stuckenia pectinata |
Viburnum foetidum |
PubChem | 21115235 |
LOTUS | LTS0144479 |
wikiData | Q105028059 |