[(2S,4S,6S,12R,13R,18R)-16-[(2S,3R,4R,5R)-3-[(2S,3R,4S,5S,6R)-5-[(2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxan-2-yl]oxy-2,6,13,17,17-pentamethyl-6-(4-methylpent-4-enyl)-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-1(20)-en-4-yl] acetate
| Internal ID | 57b3dcc9-c6d8-4b5f-9848-8bf5ffa0ec2c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2S,4S,6S,12R,13R,18R)-16-[(2S,3R,4R,5R)-3-[(2S,3R,4S,5S,6R)-5-[(2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxan-2-yl]oxy-2,6,13,17,17-pentamethyl-6-(4-methylpent-4-enyl)-8-oxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-1(20)-en-4-yl] acetate |
| SMILES (Canonical) | CC(=C)CCCC1(C2C(CC3(C2(CCC4C3=CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)OS(=O)(=O)O)O)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)OC)O)O)O)OC2C(C(C(CO2)O)O)O)C)C(=O)O1)C)OC(=O)C)C |
| SMILES (Isomeric) | CC(=C)CCC[C@]1(C2[C@H](C[C@@]3(C2(CC[C@H]4C3=CC[C@@H]5[C@@]4(CCC(C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H](CO6)OS(=O)(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)OC)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)C)C(=O)O1)C)OC(=O)C)C |
| InChI | InChI=1S/C61H96O31S/c1-25(2)11-10-16-60(8)50-30(82-26(3)65)19-59(7)28-12-13-35-57(4,5)36(15-17-58(35,6)27(28)14-18-61(50,59)56(75)91-60)86-54-48(40(70)34(24-81-54)92-93(76,77)78)90-55-49(89-51-41(71)37(67)29(66)23-80-51)42(72)45(33(22-64)85-55)87-53-44(74)47(39(69)32(21-63)84-53)88-52-43(73)46(79-9)38(68)31(20-62)83-52/h12,27,29-55,62-64,66-74H,1,10-11,13-24H2,2-9H3,(H,76,77,78)/t27-,29+,30-,31+,32+,33+,34+,35-,36?,37-,38+,39+,40-,41+,42-,43+,44+,45+,46-,47-,48+,49+,50?,51-,52-,53-,54-,55-,58+,59-,60-,61?/m0/s1 |
| InChI Key | VPUGAIGJVQSLBK-AFEVXSHQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H96O31S |
| Molecular Weight | 1357.50 g/mol |
| Exact Mass | 1356.5656274 g/mol |
| Topological Polar Surface Area (TPSA) | 469.00 Ų |
| XlogP | -1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.93% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.71% | 98.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.01% | 92.50% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.86% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.57% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 91.03% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.80% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.81% | 96.77% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.65% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 89.42% | 97.28% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.02% | 91.19% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.43% | 92.94% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.01% | 95.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.13% | 97.14% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.41% | 95.83% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.26% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.11% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.07% | 97.36% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.69% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.53% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.92% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.27% | 97.25% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.05% | 89.67% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.54% | 91.07% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.26% | 93.18% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.24% | 85.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.94% | 99.23% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.36% | 82.69% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.16% | 91.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.15% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.12% | 96.43% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.11% | 94.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.85% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.76% | 97.29% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.28% | 91.24% |
| CHEMBL5028 | O14672 | ADAM10 | 80.14% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 90660267 |
| LOTUS | LTS0070058 |
| wikiData | Q105291011 |