[(1R,2S,3R,5S,6S,7R,8S,10S,11S,14S)-11-(furan-3-yl)-6,8-dihydroxy-2,2',2',6,10-pentamethyl-6',13-dioxospiro[12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecane-5,3'-pyran]-3-yl] acetate
Internal ID | 435793b9-1531-47a0-86a5-b6ea12571090 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | [(1R,2S,3R,5S,6S,7R,8S,10S,11S,14S)-11-(furan-3-yl)-6,8-dihydroxy-2,2',2',6,10-pentamethyl-6',13-dioxospiro[12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecane-5,3'-pyran]-3-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2(C=CC(=O)OC2(C)C)C(C3C1(C45C(O4)C(=O)OC(C5(CC3O)C)C6=COC=C6)C)(C)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@]2(C=CC(=O)OC2(C)C)[C@@]([C@@H]3[C@@]1([C@]45[C@H](O4)C(=O)O[C@H]([C@@]5(C[C@@H]3O)C)C6=COC=C6)C)(C)O |
InChI | InChI=1S/C28H34O10/c1-14(29)35-17-12-27(9-7-18(31)37-23(27,2)3)26(6,33)19-16(30)11-24(4)20(15-8-10-34-13-15)36-22(32)21-28(24,38-21)25(17,19)5/h7-10,13,16-17,19-21,30,33H,11-12H2,1-6H3/t16-,17+,19-,20-,21+,24-,25+,26-,27-,28+/m0/s1 |
InChI Key | GBXAXLQNUOSFQJ-FMNYBRAXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O10 |
Molecular Weight | 530.60 g/mol |
Exact Mass | 530.21519728 g/mol |
Topological Polar Surface Area (TPSA) | 145.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of [(1R,2S,3R,5S,6S,7R,8S,10S,11S,14S)-11-(furan-3-yl)-6,8-dihydroxy-2,2',2',6,10-pentamethyl-6',13-dioxospiro[12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecane-5,3'-pyran]-3-yl] acetate 2D Structure of [(1R,2S,3R,5S,6S,7R,8S,10S,11S,14S)-11-(furan-3-yl)-6,8-dihydroxy-2,2',2',6,10-pentamethyl-6',13-dioxospiro[12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecane-5,3'-pyran]-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/00bdf140-863b-11ee-980c-43ef40e803ce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.18% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.56% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.23% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.90% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.70% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.78% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.59% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.68% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.54% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.13% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.85% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.47% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.01% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carapa grandiflora |
PubChem | 163049873 |
LOTUS | LTS0064091 |
wikiData | Q105006131 |