(2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5S,6R)-5-hydroxy-2-[(3S,4S,5R,6S)-4-hydroxy-6-[[(1S,2R,4S,5R,8R,10S,13R,14R,17S,18R)-2-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | cd3ccfa1-9c12-4392-bfa6-e6df3f0255b9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5S,6R)-5-hydroxy-2-[(3S,4S,5R,6S)-4-hydroxy-6-[[(1S,2R,4S,5R,8R,10S,13R,14R,17S,18R)-2-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(CO3)O)O)O)OC4COC(C(C4O)OC5C(C(C(C(O5)CO)O)O)O)OC6CCC7(C(C6(C)C)CCC8(C7CCC91C8(CC(C2(C9CC(CC2)(C)C)CO1)O)C)C)C)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O[C@H]4CO[C@H]([C@@H]([C@H]4O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O[C@H]6CC[C@@]7([C@H]8CC[C@@]91[C@@H]2CC(CC[C@]2(CO9)[C@@H](C[C@]1([C@@]8(CC[C@H]7C6(C)C)C)C)O)(C)C)C)CO)O)O)O)O |
| InChI | InChI=1S/C58H96O25/c1-24-34(63)39(68)42(71)48(76-24)81-44-37(66)27(20-60)78-51(46(44)83-47-41(70)35(64)25(61)21-73-47)79-28-22-74-50(45(38(28)67)82-49-43(72)40(69)36(65)26(19-59)77-49)80-33-11-12-54(6)29(53(33,4)5)9-13-55(7)30(54)10-14-58-31-17-52(2,3)15-16-57(31,23-75-58)32(62)18-56(55,58)8/h24-51,59-72H,9-23H2,1-8H3/t24-,25+,26+,27+,28-,29-,30+,31+,32+,33-,34-,35-,36+,37-,38-,39+,40-,41+,42+,43+,44-,45+,46+,47-,48-,49-,50-,51-,54-,55+,56-,57+,58-/m0/s1 |
| InChI Key | UCJHKYLRDANBFH-INKLXMQNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C58H96O25 |
| Molecular Weight | 1193.40 g/mol |
| Exact Mass | 1192.62406854 g/mol |
| Topological Polar Surface Area (TPSA) | 385.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.00% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.49% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.93% | 97.36% |
| CHEMBL233 | P35372 | Mu opioid receptor | 90.66% | 97.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.06% | 92.94% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 89.05% | 92.98% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.66% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.93% | 100.00% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 87.65% | 97.86% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.52% | 91.24% |
| CHEMBL3589 | P55263 | Adenosine kinase | 87.44% | 98.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.96% | 95.89% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 86.23% | 98.99% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.03% | 95.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.60% | 92.88% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 85.15% | 97.53% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.27% | 94.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.93% | 96.21% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.53% | 95.38% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.32% | 91.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.22% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.50% | 86.33% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.39% | 100.00% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 81.18% | 95.36% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.96% | 96.61% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.89% | 95.58% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.85% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.63% | 98.10% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.37% | 95.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.32% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ardisia gigantifolia |
| PubChem | 162898428 |
| LOTUS | LTS0215604 |
| wikiData | Q105269945 |