(1R,2R,3S,6S,7R,10S,12R)-1,10-dihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one
| Internal ID | a5e7b8dc-90df-417c-905c-4244086a712a |
| Taxonomy | Organoheterocyclic compounds > Lactones |
| IUPAC Name | (1R,2R,3S,6S,7R,10S,12R)-1,10-dihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one |
| SMILES (Canonical) | CC1CC2(C(=O)OC3C1(C2(C4C3C(C4)(C)C)C)O)O |
| SMILES (Isomeric) | C[C@@H]1C[C@]2(C(=O)O[C@H]3[C@@]1([C@]2([C@@H]4[C@H]3C(C4)(C)C)C)O)O |
| InChI | InChI=1S/C15H22O4/c1-7-5-14(17)11(16)19-10-9-8(6-12(9,2)3)13(14,4)15(7,10)18/h7-10,17-18H,5-6H2,1-4H3/t7-,8+,9-,10-,13+,14-,15+/m1/s1 |
| InChI Key | JHJQFYPUGZHONZ-LTCJEJIJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.09% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.04% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.27% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.67% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.89% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.79% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.43% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.91% | 93.04% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.38% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162993872 |
| LOTUS | LTS0132273 |
| wikiData | Q105128014 |