3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | a41bbfc9-3c11-499a-98b6-4fa6e34aac4c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)OC5C(C(C(CO5)O)O)O)C6=CC(=C(C=C6)O)OC)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O[C@@H]5[C@@H]([C@@H]([C@@H](CO5)O)O)O)C6=CC(=C(C=C6)O)OC)O)O)O)O |
InChI | InChI=1S/C33H40O20/c1-10-20(38)24(42)27(45)32(48-10)49-12-6-14(36)19-17(7-12)50-28(11-3-4-13(35)16(5-11)46-2)29(23(19)41)52-33-30(25(43)22(40)18(8-34)51-33)53-31-26(44)21(39)15(37)9-47-31/h3-7,10,15,18,20-22,24-27,30-40,42-45H,8-9H2,1-2H3/t10-,15+,18+,20-,21+,22+,24+,25-,26+,27-,30+,31+,32-,33-/m0/s1 |
InChI Key | OLALHGLMPPYOHE-LAPIIIFISA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O20 |
Molecular Weight | 756.70 g/mol |
Exact Mass | 756.21129366 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
![2D Structure of 3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/007beb80-869d-11ee-b9bb-911f6b020089.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.25% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.78% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.41% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.31% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.68% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.53% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.42% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.18% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.08% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.85% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.37% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.04% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.73% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.62% | 95.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.36% | 96.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.86% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.79% | 94.73% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.54% | 95.53% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.22% | 90.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.06% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.31% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.30% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.48% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lathyrus chrysanthus |
PubChem | 163105382 |
LOTUS | LTS0205574 |
wikiData | Q105193860 |